:CBiPES

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = N-(4'-cyano-[1,1'-biphenyl]-3-yl-N-(3-pyridinylmethyl)ethanesulfonamide

| image = CBiPES Structure.svg

| width = 200

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| IUPHAR_ligand = 3372

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 353235-01-5

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = TQ25KB5NW9

| ATC_prefix = none

| ATC_suffix =

| PubChem = 9864510

| DrugBank =

| ChemSpiderID = 8040202

| StdInChI = 1S/C21H19N3O2S/c1-2-27(25,26)24(16-18-5-4-12-23-15-18)21-7-3-6-20(13-21)19-10-8-17(14-22)9-11-19/h3-13,15H,2,16H2,1H3

| StdInChIKey = HDVYXILCBYGKGU-UHFFFAOYSA-N

| C=21 | H=19 | N=3 | O=2 | S=1

| smiles = N#Cc1ccc(cc1)-c(ccc2)cc2N(S(=O)(=O)CC)Cc3cccnc3

}}

CBiPES is a drug used in scientific research that acts as a selective positive allosteric modulator for the metabotropic glutamate receptor group II subtype mGluR2. It has potentially antipsychotic effects in animal models, and is used for researching the role of mGluR2 receptors in schizophrenia and related disorders.{{cite journal | vauthors = Johnson MP, Barda D, Britton TC, Emkey R, Hornback WJ, Jagdmann GE, McKinzie DL, Nisenbaum ES, Tizzano JP, Schoepp DD | display-authors = 6 | title = Metabotropic glutamate 2 receptor potentiators: receptor modulation, frequency-dependent synaptic activity, and efficacy in preclinical anxiety and psychosis model(s) | journal = Psychopharmacology | volume = 179 | issue = 1 | pages = 271–83 | date = April 2005 | pmid = 15717213 | doi = 10.1007/s00213-004-2099-9 | s2cid = 2699540 }}{{cite journal | vauthors = Fell MJ, Katner JS, Johnson BG, Khilevich A, Schkeryantz JM, Perry KW, Svensson KA | title = Activation of metabotropic glutamate (mGlu)2 receptors suppresses histamine release in limbic brain regions following acute ketamine challenge | journal = Neuropharmacology | volume = 58 | issue = 3 | pages = 632–9 | date = March 2010 | pmid = 19951716 | doi = 10.1016/j.neuropharm.2009.11.014 | s2cid = 7262560 }}{{cite journal | vauthors = Sanger H, Hanna L, Colvin EM, Grubisha O, Ursu D, Heinz BA, Findlay JD, Vivier RG, Sher E, Lodge D, Monn JA, Broad LM | display-authors = 6 | title = Pharmacological profiling of native group II metabotropic glutamate receptors in primary cortical neuronal cultures using a FLIPR | journal = Neuropharmacology | volume = 66 | pages = 264–73 | date = March 2013 | pmid = 22659090 | doi = 10.1016/j.neuropharm.2012.05.023 | s2cid = 42448364 }}

References

{{Reflist|2}}

{{Metabotropic glutamate receptor modulators}}

Category:Antipsychotics

Category:MGlu2 receptor agonists

Category:MGlu3 receptor agonists

Category:Benzonitriles

{{nervous-system-drug-stub}}