:CBiPES

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = N-(4'-cyano-[1,1'-biphenyl]-3-yl-N-(3-pyridinylmethyl)ethanesulfonamide

| image = CBiPES Structure.svg

| width = 200

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| IUPHAR_ligand = 3372

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 353235-01-5

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = TQ25KB5NW9

| ATC_prefix = none

| ATC_suffix =

| PubChem = 9864510

| DrugBank =

| ChemSpiderID = 8040202

| StdInChI = 1S/C21H19N3O2S/c1-2-27(25,26)24(16-18-5-4-12-23-15-18)21-7-3-6-20(13-21)19-10-8-17(14-22)9-11-19/h3-13,15H,2,16H2,1H3

| StdInChIKey = HDVYXILCBYGKGU-UHFFFAOYSA-N

| C=21 | H=19 | N=3 | O=2 | S=1

| smiles = N#Cc1ccc(cc1)-c(ccc2)cc2N(S(=O)(=O)CC)Cc3cccnc3

}}

CBiPES is a drug used in scientific research that acts as a selective positive allosteric modulator for the metabotropic glutamate receptor group II subtype mGluR₂. It has potentially antipsychotic effects in animal models, and is used for researching the role of mGluR₂ receptors in schizophrenia and related disorders.{{cite journal | vauthors = Johnson MP, Barda D, Britton TC, Emkey R, Hornback WJ, Jagdmann GE, McKinzie DL, Nisenbaum ES, Tizzano JP, Schoepp DD | display-authors = 6 | title = Metabotropic glutamate 2 receptor potentiators: receptor modulation, frequency-dependent synaptic activity, and efficacy in preclinical anxiety and psychosis model(s) | journal = Psychopharmacology | volume = 179 | issue = 1 | pages = 271–83 | date = April 2005 | pmid = 15717213 | doi = 10.1007/s00213-004-2099-9 | s2cid = 2699540 }}{{cite journal | vauthors = Fell MJ, Katner JS, Johnson BG, Khilevich A, Schkeryantz JM, Perry KW, Svensson KA | title = Activation of metabotropic glutamate (mGlu)2 receptors suppresses histamine release in limbic brain regions following acute ketamine challenge | journal = Neuropharmacology | volume = 58 | issue = 3 | pages = 632–9 | date = March 2010 | pmid = 19951716 | doi = 10.1016/j.neuropharm.2009.11.014 | s2cid = 7262560 }}{{cite journal | vauthors = Sanger H, Hanna L, Colvin EM, Grubisha O, Ursu D, Heinz BA, Findlay JD, Vivier RG, Sher E, Lodge D, Monn JA, Broad LM | display-authors = 6 | title = Pharmacological profiling of native group II metabotropic glutamate receptors in primary cortical neuronal cultures using a FLIPR | journal = Neuropharmacology | volume = 66 | pages = 264–73 | date = March 2013 | pmid = 22659090 | doi = 10.1016/j.neuropharm.2012.05.023 | s2cid = 42448364 }}