:CJ-033466

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 450386388

| IUPAC_name = 5-amino-6-chloro-2-methyl-N-[[1-(2-methylpropyl)piperidin-4-yl]methyl]imidazo[1,2-a]pyridine-8-carboxamide

| image = CJ-033466.svg

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 519148-48-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 9KUW8W70PJ

| ATC_prefix =

| ATC_suffix =

| PubChem = 10429706

| ChemSpiderID = 8605134

| C=19 | H=28 | Cl=1 | N=5 | O=1

| smiles = C3CN(CC(C)C)CCC3CNC(=O)c1cc(Cl)c(N)n(cc2C)c1n2

| StdInChI = 1S/C19H28ClN5O/c1-12(2)10-24-6-4-14(5-7-24)9-22-19(26)15-8-16(20)17(21)25-11-13(3)23-18(15)25/h8,11-12,14H,4-7,9-10,21H2,1-3H3,(H,22,26)

| StdInChIKey = ISKHMDNIWXPUGR-UHFFFAOYSA-N

| melting_point =

| melting_high =

}}

CJ-033466 is a drug which acts as a potent and selective 5-HT₄ serotonin receptor partial agonist. In animal tests it stimulated gastrointestinal motility with 30 times the potency of cisapride, and with lower affinity for the hERG channel.{{cite journal |vauthors=Mikami T, Ochi Y, Suzuki K, Saito T, Sugie Y, Sakakibara M |title=5-Amino-6-chloro-N-[(1-isobutylpiperidin-4-yl)methyl]-2-methylimidazo[1,2-alpha]pyridine-8-carboxamide (CJ-033,466), a novel and selective 5-hydroxytryptamine4 receptor partial agonist: pharmacological profile in vitro and gastroprokinetic effect in conscious dogs |journal=The Journal of Pharmacology and Experimental Therapeutics |volume=325 |issue=1 |pages=190–9 |date=April 2008 |pmid=18198343 |doi=10.1124/jpet.107.133850 |s2cid=40500864 }}{{cite journal |vauthors=Toga T, Kohmura Y, Kawatsu R |title=The 5-HT(4) agonists cisapride, mosapride, and CJ-033466, a Novel potent compound, exhibit different human ether-a-go-go-related gene (hERG)-blocking activities |journal=Journal of Pharmacological Sciences |volume=105 |issue=2 |pages=207–10 |date=October 2007 |pmid=17928736 |doi= 10.1254/jphs.sc0070243|doi-access=free }}{{cite journal |vauthors=Tsuchida Y, Hatao F, Fujisawa M, Murata T, Kaminishi M, Seto Y, Hori M, Ozaki H |title=Neuronal stimulation with 5-hydroxytryptamine 4 receptor induces anti-inflammatory actions via α7nACh receptors on muscularis macrophages associated with postoperative ileus |journal=Gut |volume=60 |issue=5 |pages=638–47 |date=May 2011 |pmid=21115544 |pmc=3071096 |doi=10.1136/gut.2010.227546 }}