:CP-809101

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 451224368

| IUPAC_name = 2-[(3-Chlorophenyl)methoxy]-6-(1-piperazinyl)pyrazine

| image = CP-809101 Structure.svg

| width = 220

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 479683-64-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = A2EXW95647

| ATC_prefix = None

| ATC_suffix =

| PubChem = 9901086

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 8076740

| C=15 | H=17 | Cl=1 | N=4 | O=1

| smiles = C2CNCCN2c(n3)cncc3OCc(c1)cccc1Cl

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C15H17ClN4O/c16-13-3-1-2-12(8-13)11-21-15-10-18-9-14(19-15)20-6-4-17-5-7-20/h1-3,8-10,17H,4-7,11H2

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = PCWGGOVOEWHPMG-UHFFFAOYSA-N

| melting_point =

| melting_high =

}}

CP-809101 is a drug which acts as a potent and selective 5-HT_2C receptor agonist.{{cite journal |vauthors=Strong PV, Greenwood BN, Fleshner M |title=The effects of the selective 5-HT(2C) receptor antagonist SB 242084 on learned helplessness in male Fischer 344 rats |journal=Psychopharmacology |volume=203 |issue=4 |pages=665–75 |date=May 2009 |pmid=19037632 |doi=10.1007/s00213-008-1413-3 |s2cid=24956531 }} It had promising results in animal models of obesity and psychosis, but associated with genotoxicity which means that future use will be restricted to scientific research applications only.{{cite journal |vauthors=Siuciak JA, Chapin DS, McCarthy SA, Guanowsky V, Brown J, Chiang P, Marala R, Patterson T, Seymour PA, Swick A, Iredale PA |title=CP-809,101, a selective 5-HT2C agonist, shows activity in animal models of antipsychotic activity |journal=Neuropharmacology |volume=52 |issue=2 |pages=279–90 |date=February 2007 |pmid=16949622 |doi=10.1016/j.neuropharm.2006.07.024 |s2cid=46489320 }}{{cite journal |vauthors=Kalgutkar AS, Dalvie DK, Aubrecht J, Smith EB, Coffing SL, Cheung JR, Vage C, Lame ME, Chiang P, McClure KF, Maurer TS, Coelho RV, Soliman VF, Schildknegt K |title=Genotoxicity of 2-(3-chlorobenzyloxy)-6-(piperazinyl)pyrazine, a novel 5-hydroxytryptamine2c receptor agonist for the treatment of obesity: role of metabolic activation |journal=Drug Metabolism and Disposition |volume=35 |issue=6 |pages=848–58 |date=June 2007 |pmid=17344339 |doi=10.1124/dmd.106.013649 |s2cid=29863246 |url=http://pdfs.semanticscholar.org/72b2/41dd694746eaa4424134533804fd4a53bfd2.pdf |archive-url=https://web.archive.org/web/20190225184746/http://pdfs.semanticscholar.org/72b2/41dd694746eaa4424134533804fd4a53bfd2.pdf |url-status=dead |archive-date=2019-02-25 }}