:Carboxycyclophosphamide

{{Chembox

| ImageFile = Carboxycyclophosphamide.svg

| ImageSize = 200

| ImageAlt = Carboxycyclophosphamide chemical structure

| PIN = 3-({Amino[bis(2-chloroethyl)amino]phosphoryl}oxy)propanoic acid

| OtherNames = Carboxyphosphamide

| Section1 = {{Chembox Identifiers

| CASNo = 22788-18-7

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = DP4677AX41

| PubChem = 31515

| SMILES = C(COP(=O)(N)N(CCCl)CCCl)C(=O)O

| ChemSpiderID = 29229

| InChI = 1/C7H15Cl2N2O4P/c8-2-4-11(5-3-9)16(10,14)15-6-1-7(12)13/h1-6H2,(H2,10,14)(H,12,13)

| InChIKey = QLAKAJLYYGOZQL-UHFFFAOYAS

| StdInChI = 1S/C7H15Cl2N2O4P/c8-2-4-11(5-3-9)16(10,14)15-6-1-7(12)13/h1-6H2,(H2,10,14)(H,12,13)

| StdInChIKey = QLAKAJLYYGOZQL-UHFFFAOYSA-N

}}

| Section2 = {{Chembox Properties

| Formula = C₇H₁₅Cl₂N₂O₄P

| MolarMass = 293.084762

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Carboxycyclophosphamide is an inactive metabolite of the cytotoxic antineoplastic drug cyclophosphamide. In the metabolic pathway of cyclophosphamide inactivation it first metabolizes to 4-hydroxycyclophosphamide, then partially tautomerizes into aldophosphamide. Aldophosphamide then, in turn, is oxidized into carboxycyclophosphamide by the enzyme ALDH (aldehyde dehydrogenase).{{cite journal| pmid=1610409 | volume=43 | title=Identification of human liver aldehyde dehydrogenases that catalyze the oxidation of aldophosphamide and retinaldehyde | year=1992 | journal=Biochem Pharmacol | pages=2453–69 | last1 = Dockham | first1 = PA | last2 = Lee | first2 = MO | last3 = Sladek | first3 = NE | issue=11 | doi=10.1016/0006-2952(92)90326-e}}