:Cepharanthine

{{Short description|Chemical compound}}

{{Infobox drug

| drug_name =

| IUPAC_name = (14S,27R)-22,33-dimethoxy-13,28-dimethyl-2,5,7,20-tetraoxa-13,28-diazaoctacyclo[25.6.2.2^16,19.1^3,10.1^21,25.0^4,8.0^31,35.0^14,39]nonatriaconta-1(33),3(39),4(8),9,16(38),17,19(37),21,23,25(36),31,34-dodecaene

| image = Cepharanthine-.png

| alt =

| caption =

| tradename =

| Drugs.com = {{Drugs.com|international|cepharanthine}}

| MedlinePlus =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category=

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 481-49-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7592YJ0J6T

| ATCvet =

| ATC_prefix = none

| ATC_suffix =

| PubChem = 10206

| ChEMBL = 449782

| ChemSpiderID = 9791

| DrugBank =

| synonyms = Cepharantin, O-Methylcepharanoline

| C = 37 | H = 38 | N = 2 | O = 6

| smiles = CN1CCC2=CC3=C(C4=C2[C@@H]1CC5=CC=C(C=C5)OC6=C(C=CC(=C6)C[C@@H]7C8=CC(=C(C=C8CCN7C)OC)O4)OC)OCO3

| StdInChI = 1S/C37H38N2O6/c1-38-13-11-24-18-31(41-4)33-20-27(24)28(38)16-23-7-10-30(40-3)32(17-23)44-26-8-5-22(6-9-26)15-29-35-25(12-14-39(29)2)19-34-36(37(35)45-33)43-21-42-34/h5-10,17-20,28-29H,11-16,21H2,1-4H3/t28-,29+/m1/s1

| StdInChIKey = YVPXVXANRNDGTA-WDYNHAJCSA-N

}}

Cepharanthine is an antiinflammatory and antineoplastic compound isolated from Stephania.{{cite journal | vauthors = Huang H, Hu G, Wang C, Xu H, Chen X, Qian A | s2cid = 7186762 | title = Cepharanthine, an alkaloid from Stephania cepharantha Hayata, inhibits the inflammatory response in the RAW264.7 cell and mouse models | journal = Inflammation | volume = 37 | issue = 1 | pages = 235–46 | date = February 2014 | pmid = 24045962 | doi = 10.1007/s10753-013-9734-8 }} Due to these modalities, it has been shown effective against HTLV in lab research. {{cite journal | vauthors = Toyama M, Hamasaki T, Uto T, Aoyama H, Okamoto M, Hashmoto Y, Baba M | title = Synergistic inhibition of HTLV-1-infected cell proliferation by combination of cepharanthine and a tetramethylnaphthalene derivative | journal = Anticancer Research | volume = 32 | issue = 7 | pages = 2639–45 | date = July 2012 | pmid = 22753721 | url = http://ar.iiarjournals.org/content/32/7/2639.long }} Additionally, it has successfully been used to treat a diverse range of medical conditions, including radiation-induced leukopenia, idiopathic thrombocytopenic purpura, alopecia areata, alopecia pityrodes, venomous snakebites, xerostomia, sarcoidosis, refractory anemia and various cancer-related conditions. No safety issues have been observed with CEP, and side effects are very rarely reported. {{cite journal | vauthors = Rogosnitzky M, Danks R | title = Therapeutic potential of the biscoclaurine alkaloid, cepharanthine, for a range of clinical conditions | journal = Pharmacological Reports | year = 2011 | volume = 63 | issue = 2 | pages = 337–47 | pmid = 21602589 | doi = 10.1016/S1734-1140(11)70500-X | url = http://www.if-pan.krakow.pl/pjp/pdf/2011/2_337.pdf }}