:Chloroxymorphamine

{{Chembox

| ImageFile = Chloroxymorphamine Structure.svg

| ImageClass = skin-invert-image

| ImageSize = 220px

| ImageFile2 = Chloroxymorphamine 3D BS.png

| ImageClass2 = bg-transparent

| ImageSize2 = 220px

| IUPACName =

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 71360-45-7

| CASNo_Ref = {{cascite|correct|CAS}}

| PubChem = 5490620

| ChemSpiderID = 4590365

| StdInChI = 1S/C21H28Cl2N2O3/c1-24-9-6-20-17-13-2-3-15(26)18(17)28-19(20)14(25(10-7-22)11-8-23)4-5-21(20,27)16(24)12-13/h2-3,14,16,19,26-27H,4-12H2,1H3/t14-,16-,19+,20+,21-/m1/s1

| StdInChIKey = KAFQZFNWIPBPJR-GQHLEUQBSA-N

| SMILES = CN1CC[C@]23c4c5ccc(c4O[C@H]2[C@@H](CC[C@]3([C@H]1C5)O)N(CCCl)CCCl)O

}}

|Section2={{Chembox Properties

| Formula =

| MolarMass =

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Chloroxymorphamine is an opioid and a derivative of oxymorphone which binds irreversibly as an agonist to the μ-opioid receptor.{{cite journal|title=Chloroxymorphamine, and opioid receptor site-directed alkylating agent having narcotic agonist activity|pmid=86208|bibcode=1979Sci...204..316C|last1=Caruso|first1=Thomas P.|last2=Takemori|last3=Larson|last4=Portoghese|volume=204|year=1979|pages=316–8|journal=Science|doi=10.1126/science.86208|first2=AE|first3=DL|first4=PS|issue=4390}}