:Chrysoeriol

{{Chembox

| ImageFile = Chrysoeriol.svg

| ImageSize = 200px

| ImageAlt =

| ImageFile2 = Chrysoeriol 3D BS.png

| ImageSize2 = 200px

| ImageAlt2 =

| IUPACName = 4′,5,7-Trihydroxy-3′-methoxyflavone

| SystematicName = 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-1-benzopyran-4-one

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 491-71-4

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = Q813145M20

| PubChem = 5280666

| ChemSpiderID = 4444263

| SMILES = COC1=C(C=CC(=C1)C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O

| InChI = 1/C16H12O6/c1-21-14-4-8(2-3-10(14)18)13-7-12(20)16-11(19)5-9(17)6-15(16)22-13/h2-7,17-19H,1H3

| InChIKey = SCZVLDHREVKTSH-UHFFFAOYAS

| StdInChI = 1S/C16H12O6/c1-21-14-4-8(2-3-10(14)18)13-7-12(20)16-11(19)5-9(17)6-15(16)22-13/h2-7,17-19H,1H3

| StdInChIKey = SCZVLDHREVKTSH-UHFFFAOYSA-N}}

|Section2={{Chembox Properties

| C=16 | H=12 | O=6

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Chrysoeriol is a flavone, chemically the 3'-methoxy derivative of luteolin.

Related compounds

Diosmetin is one of three possible regioisomers of chrysoeriol.

Natural sources

Found in Artemisia.

Pharmacodynamics

Vasorelaxant and hypotensive activity in vitro and in vivo in a murine model by intravenous infusion.{{cite journal | pmid = 23588093 | doi=10.1016/j.jep.2013.03.061 | volume=148 | issue=1 | title=Artemisia copa aqueous extract as vasorelaxant and hypotensive agent | journal=J Ethnopharmacol | pages=56–61 | last1 = Gorzalczany | first1 = S | last2 = Moscatelli | first2 = V | last3 = Ferraro | first3 = G| year=2013 }}

See also

  • Cannflavins, prenylated derivatives of chrysoeriol

References

{{reflist}}