:Chrysoeriol
{{Chembox
| ImageFile = Chrysoeriol.svg
| ImageSize = 200px
| ImageAlt =
| ImageFile2 = Chrysoeriol 3D BS.png
| ImageSize2 = 200px
| ImageAlt2 =
| IUPACName = 4′,5,7-Trihydroxy-3′-methoxyflavone
| SystematicName = 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-1-benzopyran-4-one
| OtherNames =
|Section1={{Chembox Identifiers
| CASNo = 491-71-4
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = Q813145M20
| PubChem = 5280666
| ChemSpiderID = 4444263
| SMILES = COC1=C(C=CC(=C1)C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O
| InChI = 1/C16H12O6/c1-21-14-4-8(2-3-10(14)18)13-7-12(20)16-11(19)5-9(17)6-15(16)22-13/h2-7,17-19H,1H3
| InChIKey = SCZVLDHREVKTSH-UHFFFAOYAS
| StdInChI = 1S/C16H12O6/c1-21-14-4-8(2-3-10(14)18)13-7-12(20)16-11(19)5-9(17)6-15(16)22-13/h2-7,17-19H,1H3
| StdInChIKey = SCZVLDHREVKTSH-UHFFFAOYSA-N}}
|Section2={{Chembox Properties
| C=16 | H=12 | O=6
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}
Chrysoeriol is a flavone, chemically the 3'-methoxy derivative of luteolin.
Related compounds
Diosmetin is one of three possible regioisomers of chrysoeriol.
Natural sources
Found in Artemisia.
Pharmacodynamics
Vasorelaxant and hypotensive activity in vitro and in vivo in a murine model by intravenous infusion.{{cite journal | pmid = 23588093 | doi=10.1016/j.jep.2013.03.061 | volume=148 | issue=1 | title=Artemisia copa aqueous extract as vasorelaxant and hypotensive agent | journal=J Ethnopharmacol | pages=56–61 | last1 = Gorzalczany | first1 = S | last2 = Moscatelli | first2 = V | last3 = Ferraro | first3 = G| year=2013 }}
See also
- Cannflavins, prenylated derivatives of chrysoeriol
References
{{reflist}}
External links
- [https://www.ncbi.nlm.nih.gov/pubmed/23588093 Artemisia copa aqueous extract as vasorelaxant and hypotensive agent]
{{Flavone}}
Category:O-methylated flavones
{{aromatic-stub}}