:Cirsilineol

{{Chembox

| ImageFile = Cirsilineol.svg

| ImageSize = 240px

| ImageAlt =

| IUPACName = 4′,5-Dihydroxy-3′,6,7-trimethoxyflavone

| SystematicName = 5-Hydroxy-2-(4-hydroxy-3-methoxyphenyl)-6,7-dimethoxy-4H-1-benzopyran-4-one

| OtherNames = Eupatrin

|Section1={{Chembox Identifiers

| CASNo = 41365-32-6

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 08DZZ529FE

| PubChem = 162464

| ChemSpiderID = 142644

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 3718

| StdInChI = 1S/C18H16O7/c1-22-13-6-9(4-5-10(13)19)12-7-11(20)16-14(25-12)8-15(23-2)18(24-3)17(16)21/h4-8,19,21H,1-3H3

| StdInChIKey = VKOSQMWSWLZQPA-UHFFFAOYSA-N

| InChI=1S/C18H16O7/c1-22-13-6-9(4-5-10(13)19)12-7-11(20)16-14(25-12)8-15(23-2)18(24-3)17(16)21/h4-8,19,21H,1-3H3

| InChIKey = VKOSQMWSWLZQPA-UHFFFAOYSA-N

| SMILES = COC1=C(C=CC(=C1)C2=CC(=O)C3=C(C(=C(C=C3O2)OC)OC)O)O}}

|Section2={{Chembox Properties

| C=18 | H=16 | O=7

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Cirsilineol is a bioactive flavone isolated from Artemisia{{cite journal|pmid=18957174|year=2008|last1=Sheng|first1=X|last2=Sun|first2=Y|last3=Yin|first3=Y|last4=Chen|first4=T|last5=Xu|first5=Q|title=Cirsilineol inhibits proliferation of cancer cells by inducing apoptosis via mitochondrial pathway|volume=60|issue=11|pages=1523–9|doi=10.1211/jpp/60.11.0014|journal=The Journal of Pharmacy and Pharmacology|doi-access=free}} and from Teucrium gnaphalodes.Flavonoid Aglycones and Glycosides from Teucrium gnaphalodes. F. A. T. Barberán, M. I. Gil, F. Tomás, F. Ferreres and A. Arques, J. Nat. Prod., 1985, 48 (5), pages 859–860, {{doi|10.1021/np50041a040}}