:Citromycin

{{Chembox

| ImageFile = Citromycin Structure.svg

| ImageSize =

| ImageAlt =

| PIN = 8,9-Dihydroxy-2-methyl-4H,5H-pyrano[3,2-c][1]benzopyran-4-one

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 37209-30-6

| CASNo_Ref = {{cascite|correct|CAS}}

| PubChem = 3084655

| ChemSpiderID = 2341687

| SMILES = CC1=CC(=O)C2=C(O1)C3=CC(=C(C=C3OC2)O)O

| InChI = 1/C13H10O5/c1-6-2-9(14)8-5-17-12-4-11(16)10(15)3-7(12)13(8)18-6/h2-4,15-16H,5H2,1H3

| InChIKey = QZZUHPUWIRSQPB-UHFFFAOYAO

| StdInChI = 1S/C13H10O5/c1-6-2-9(14)8-5-17-12-4-11(16)10(15)3-7(12)13(8)18-6/h2-4,15-16H,5H2,1H3

| StdInChIKey = QZZUHPUWIRSQPB-UHFFFAOYSA-N}}

|Section2={{Chembox Properties

| C=13 | H=10 | O=5

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Citromycin is a chemical compound produced by Penicillium.{{cite journal|pmid=17958395|year=2007|last1=Capon|first1=RJ|last2=Stewart|first2=M|last3=Ratnayake|first3=R|last4=Lacey|first4=E|last5=Gill|first5=JH|title=Citromycetins and bilains A-C: New aromatic polyketides and diketopiperazines from Australian marine-derived and terrestrial Penicillium spp|volume=70|issue=11|pages=1746–52|doi=10.1021/np0702483|journal=Journal of Natural Products}} It was first discovered in 1969 and was found to have weak antibiotic activity.{{cite journal | pmid = 4978096| year = 1969| last1 = Kusakabe| first1 = Y| title = Citromycin, a new antibiotic. I. Isolation and characterization| journal = The Journal of Antibiotics| volume = 22| issue = 3| pages = 112–8| last2 = Yamauchi| first2 = Y| last3 = Nagatsu| first3 = C| last4 = Abe| first4 = H| last5 = Akasaki| first5 = K| doi=10.7164/antibiotics.22.112| doi-access = free}}