:Clopimozide

{{short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 3-[1-[4,4-bis(4-fluorophenyl)butyl]-4-piperidyl]-6-chloro-1H-benzimidazol-2-one

| image = Clopimozide.svg

| width = 270

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 53179-12-7

| ATC_prefix = none

| ATC_suffix =

| PubChem = 65449

| ChEMBL = 2104161

| ChemSpiderID = 58909

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7C6TA32SD2

| KEGG = D02649

| C=28 | H=28 | Cl=1 | F=2 | N=3 | O=1

| smiles = Fc1ccc(cc1)C(c2ccc(F)cc2)CCCN5CCC(N4c3ccc(Cl)cc3NC4=O)CC5

| StdInChI = 1S/C28H28ClF2N3O/c29-21-7-12-27-26(18-21)32-28(35)34(27)24-13-16-33(17-14-24)15-1-2-25(19-3-8-22(30)9-4-19)20-5-10-23(31)11-6-20/h3-12,18,24-25H,1-2,13-17H2,(H,32,35)

| StdInChIKey = JCZYXTVBWHAWLL-UHFFFAOYSA-N

}}

Clopimozide (R-29,764) is a typical antipsychotic drug of the diphenylbutylpiperidine class.{{cite journal | vauthors = De Cuyper HJ, Van Praag HM, Mulder WR | title = Therapeutical significance of clopimozide in the treatment of chronic psychotic patients | journal = Acta Psychiatrica Scandinavica | volume = 59 | issue = 5 | pages = 561–74 |date=May 1979 | pmid = 37697 | doi = 10.1111/j.1600-0447.1979.tb00256.x| s2cid = 30954603 }}{{cite journal | vauthors = Knapen J, Bollen J, Brugmanns J, Rombaut N | title = [Treatment of chronic psychoses with oral clopimozide] | language = fr | journal = Acta Psychiatrica Belgica | volume = 76 | issue = 4 | pages = 644–57 | year = 1976 | pmid = 798469 }} It is very potent and has an extremely long duration of action, lasting at least one week with a single dose.{{cite journal | vauthors = Janssen PA, Niemegeers CJ, Schellekens KH, Lenaerts FM, Wauquier A | title = Clopimozide (R 29 764), a new highly potent and orally long-acting neuroleptic of the diphenylbutylpiperidine series | journal = Arzneimittel-Forschung | volume = 25 | issue = 8 | pages = 1287–94 |date=August 1975 | pmid = 1242360 }}{{cite journal | vauthors = Floru L, Tegeler J | title = Clinical experiments with the new oral long-acting neuroleptic clopimozide (R 29 764) | journal = Arzneimittel-Forschung | volume = 28 | issue = 2 | pages = 341–4 | year = 1978 | pmid = 25071 }}{{cite journal | vauthors = Bobon J, Parent M, Toussaint C, Pinchard A | title = [Long-acting neuroleptics. IV. Preliminary study of clopimozide (R 29764)] | language = fr | journal = Acta Psychiatrica Belgica | volume = 76 | issue = 1 | pages = 138–43 | year = 1976 | pmid = 970182 }} It was developed by Janssen Pharmaceutica but was never marketed.