:Clovoxamine

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 444453889

| IUPAC_name = 1-(4-chlorophenyl)-5-methoxypentan-1-one O-2-aminoethyl oxime

| image = Clovoxamine Structure.svg

| tradename =

| pregnancy_category =

| legal_status = Uncontrolled

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| index2_label = fumarate

| CAS_number2_Ref = {{cascite|correct|CAS}}

| CAS_number2 = 54739-21-8

| UNII2_Ref = {{fdacite|correct|FDA}}

| UNII2 = 21VG81S0IX

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 54739-19-4

| ATC_prefix = none

| PubChem = 6335903

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2105603

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7I22J7RY2A

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 4891461

| C=14 | H=21 | Cl=1 | N=2 | O=2

| smiles = COCCCCC(=NOCCN)C1=CC=C(C=C1)Cl

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C14H21ClN2O2/c1-18-10-3-2-4-14(17-19-11-9-16)12-5-7-13(15)8-6-12/h5-8H,2-4,9-11,16H2,1H3/b17-14+

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = XXPVSQRPGBUFKM-SAPNQHFASA-N

}}

Clovoxamine (INN) (developmental code name DU-23811) is a drug that was discovered in the 1970s and was subsequently investigated as an antidepressant and anxiolytic agent but was never marketed.{{cite journal | vauthors = Freeman HL, Wakelin JS, Calanca A, Hole G | title = Initial clinical evaluation of a new nontricyclic antidepressant: clovoxamine | journal = Advances in Biochemical Psychopharmacology | volume = 32 | pages = 69–75 | year = 1982 | pmid = 7046368 }}{{cite journal | vauthors = Jesinger DK, Gostick N | title = Anxiety neurosis in general practice. A double-blind comparative study of diazepam and clovoxamine, a novel inhibitor of noradrenaline and serotonin reuptake | journal = International Clinical Psychopharmacology | volume = 4 | issue = 4 | pages = 301–11 | date = October 1989 | pmid = 2691573 | doi = 10.1097/00004850-198910000-00005 }}{{cite journal | vauthors = Hurst HE, Jones DR, Wright JH, Jarboe CH | title = Clovoxamine kinetics in an early clinical trial | journal = Clinical Pharmacology and Therapeutics | volume = 34 | issue = 2 | pages = 266–71 | date = August 1983 | pmid = 6872422 | doi = 10.1038/clpt.1983.164 | s2cid = 42205772 }} It acts as a serotonin-norepinephrine reuptake inhibitor (SNRI), with little affinity for the muscarinic acetylcholine, histamine, adrenergic, and serotonin receptors.{{cite journal | vauthors = Saletu B, Grünberger J, Rajna P, Karobath M | s2cid = 6483654 | title = Clovoxamine and fluvoxamine-2 biogenic amine re-uptake inhibiting antidepressants: quantitative EEG, psychometric and pharmacokinetic studies in man | journal = Journal of Neural Transmission | volume = 49 | issue = 1–2 | pages = 63–86 | year = 1980 | pmid = 6777458 | doi = 10.1007/BF01249190 }}{{cite journal | vauthors = Bradford LD, Tulp MT, Schipper J | title = Biochemical effects in rats after acute and long-term treatment with clovoxamine | journal = Archives Internationales de Pharmacodynamie et de Therapie | volume = 287 | issue = 2 | pages = 188–202 | date = June 1987 | pmid = 2820327 }} The compound is structurally related to fluvoxamine.