:Cloxotestosterone

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = (8R,9S,10R,13S,14S,17S)-10,13-dimethyl-17-(2,2,2-trichloro-1-hydroxyethoxy)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one

| image = Cloxotestosterone.svg

| width = 225px

| image2 = Cloxotestosterone molecule ball.png

| width2 = 225px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 53608-96-1

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 20055048

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 16736057

| UNII = 8422DH508N

| KEGG =

| ChEBI =

| ChEMBL = 2106514

| synonyms = 17β-Chloral hemiacetal testosterone; (17β)-17-(2,2,2-Trichloro-1-hydroxyethoxy)androst-4-en-3-one

| C=21 | H=29 | Cl=3 | O=3

| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2OC(C(Cl)(Cl)Cl)O)CCC4=CC(=O)CC[C@]34C

| StdInChI_Ref =

| StdInChI = 1S/C21H29Cl3O3/c1-19-9-7-13(25)11-12(19)3-4-14-15-5-6-17(27-18(26)21(22,23)24)20(15,2)10-8-16(14)19/h11,14-18,26H,3-10H2,1-2H3/t14-,15-,16-,17-,18?,19-,20-/m0/s1

| StdInChIKey_Ref =

| StdInChIKey = DNADMXUXHNLBKR-SIGPKOBDSA-N

}}

Cloxotestosterone ({{abbrlink|INN|International Nonproprietary Name}}),{{Cite web | url=https://chem.nlm.nih.gov/chemidplus/rn/53608-96-1 | work = ChemIDplus | publisher = U.S. National Library of Medicine | title = Cloxotestosterone }} also known as 17β-chloral hemiacetal testosterone, is a synthetic anabolic–androgenic steroid (AAS) and an androgen ether – specifically, the 17β-trichloro hemiacetal ether of testosterone – which was never marketed.{{cite book | vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA641|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=641–}} The O-acetate ester of cloxotestosterone, cloxotestosterone acetate (brand name Caprosem), in contrast to cloxotestosterone, has been marketed.