:Cloxotestosterone
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields =
| Watchedfields =
| verifiedrevid =
| IUPAC_name = (8R,9S,10R,13S,14S,17S)-10,13-dimethyl-17-(2,2,2-trichloro-1-hydroxyethoxy)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one
| image = Cloxotestosterone.svg
| width = 225px
| image2 = Cloxotestosterone molecule ball.png
| width2 = 225px
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref =
| CAS_number = 53608-96-1
| CAS_supplemental =
| ATC_prefix =
| ATC_suffix =
| ATC_supplemental =
| PubChem = 20055048
| IUPHAR_ligand =
| DrugBank_Ref =
| DrugBank =
| ChemSpiderID_Ref =
| ChemSpiderID = 16736057
| UNII = 8422DH508N
| KEGG =
| ChEBI =
| ChEMBL = 2106514
| synonyms = 17β-Chloral hemiacetal testosterone; (17β)-17-(2,2,2-Trichloro-1-hydroxyethoxy)androst-4-en-3-one
| C=21 | H=29 | Cl=3 | O=3
| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2OC(C(Cl)(Cl)Cl)O)CCC4=CC(=O)CC[C@]34C
| StdInChI_Ref =
| StdInChI = 1S/C21H29Cl3O3/c1-19-9-7-13(25)11-12(19)3-4-14-15-5-6-17(27-18(26)21(22,23)24)20(15,2)10-8-16(14)19/h11,14-18,26H,3-10H2,1-2H3/t14-,15-,16-,17-,18?,19-,20-/m0/s1
| StdInChIKey_Ref =
| StdInChIKey = DNADMXUXHNLBKR-SIGPKOBDSA-N
}}
Cloxotestosterone ({{abbrlink|INN|International Nonproprietary Name}}),{{Cite web | url=https://chem.nlm.nih.gov/chemidplus/rn/53608-96-1 | work = ChemIDplus | publisher = U.S. National Library of Medicine | title = Cloxotestosterone }} also known as 17β-chloral hemiacetal testosterone, is a synthetic anabolic–androgenic steroid (AAS) and an androgen ether – specifically, the 17β-trichloro hemiacetal ether of testosterone – which was never marketed.{{cite book | vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA641|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=641–}} The O-acetate ester of cloxotestosterone, cloxotestosterone acetate (brand name Caprosem), in contrast to cloxotestosterone, has been marketed.
See also
References
{{Reflist}}
{{Androgen receptor modulators}}
Category:Anabolic–androgenic steroids
Category:Trichloromethyl compounds
{{Steroid-stub}}
{{Genito-urinary-drug-stub}}