:Cocamide MEA

{{Chembox

| ImageFile = Cocoamide monoethanolamine.svg

| ImageSize = 250px

| ImageCaption = Cocoamide MEA

| IUPACName = N-(2-hydroxyethyl)dodecanamide

| OtherNames = Cocamide monoethanolamine; Monoethanolamine coconut acid amide; Coco monoethanolamide; Coconut fatty acid monoethanolamide; Cocoyl monoethanolamine; N-(2-Hydroxyethyl) coco fatty acid amide; Coconut oil fatty acid ethanolamide

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 68140-00-1

| PubChem = 8899

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = C80684146D

| ChEBI = 85263

| ChEMBL = 246914

| EC_number = 268-770-2

| InChI=1S/C14H29NO2/c1-2-3-4-5-6-7-8-9-10-11-14(17)15-12-13-16/h16H,2-13H2,1H3,(H,15,17)

| InChIKey = QZXSMBBFBXPQHI-UHFFFAOYSA-N

| SMILES = CCCCCCCCCCCC(=O)NCCO

| ChemSpiderID = none

}}

|Section2={{Chembox Properties

| Formula = CH₃(CH₂)_nCONHCH₂CH₂OH

| MolarMass =

| Appearance =

| Density = 1.08-1.09 g/cm³[http://chemicalland21.com/specialtychem/NH/COCAMIDE%20MEA.htm Cocamide MEA], chemicalland21.com

| MeltingPtC = 60 to 63

| MeltingPt_ref = {{cn|date=November 2014}}

| BoilingPt = >

| BoilingPtC = 200

| BoilingPt_ref =

| Solubility =

}}

|Section3={{Chembox Hazards

| LD50 = > 3000 mg/kg (oral, rat)

| MainHazards =

| FlashPt =

| AutoignitionPt =

| GHSPictograms = {{GHS05}}{{GHS07}}{{GHS09}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|315|318}}

| PPhrases = {{P-phrases|264|270|273|280|301+312|302+352|305+351+338|310|321|330|332+313|362|391|501}}

}}

}}

Cocamide MEA, or cocamide monoethanolamine, is a solid, off-white to tan compound, often sold in flaked form. The solid melts to yield a pale yellow viscous clear liquid. It is a mixture of fatty acid amides which is produced from the fatty acids in coconut oil when reacted with ethanolamine.