:Coelenteramine

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 420873497

| ImageFile=Coelenteramine.svg

| ImageSize=200px

| PIN=3-Benzyl-5-(4-hydroxyphenyl)pyrazin-2-amine

| OtherNames=Coelenteramine, 2-Amino-3-benzyl-5-(p-hydroxyphenyl)pyrazine

|Section1={{Chembox Identifiers

| CASNo=37156-84-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = CE63ZJ743V

| PubChem=193743

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 18979379

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C17H15N3O/c18-17-15(10-12-4-2-1-3-5-12)20-16(11-19-17)13-6-8-14(21)9-7-13/h1-9,11,21H,10H2,(H2,18,19)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = BWNPYAKFDUFNND-UHFFFAOYSA-N

| SMILES=C1=CC=C(C=C1)CC2=NC(=CN=C2N)C3=CC=C(C=C3)O

}}

|Section2={{Chembox Properties

| C=17 | H=15 | N=3 | O=1

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Coelenteramine is a metabolic product of the bioluminescent reactions in organisms that utilize coelenterazine. It was first isolated from Aequorea victoria along with coelenteramide after coelenterates were stimulated to emit light.{{cite journal | doi = 10.1073/pnas.72.4.1546 | author = Shimomura O, Johnson FH | title = Chemical Nature of Bioluminescence Systems in Coelenterates | journal = PNAS USA | volume = 72 | pages = 1546–1549 | year = 1975 | pmid = 236561 | issue = 4 | pmc = 432574| doi-access = free }}