:Copper aspirinate

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 418579364

| ImageFile1 = Copper_aspirinate.jpg

| ImageSize1 =

| ImageFile2 = Cu2(asp)4.png

| ImageSize2 =

| IUPACName = dicopper 2-acetyloxybenzoate

| OtherNames = tetrakis-μ-acetylsalicylato-dicopper(II),
copper(II) aspirinate, cupric acetylsalicylate, cupric aspirinate, cupric aspirin complex

| Section1 = {{Chembox Identifiers

| Abbreviations =

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 23642-01-5

| EINECS =

| PubChem = 92244

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 83280

| SMILES = CC(=O)Oc1ccccc1C(=O)[O-].CC(=O)Oc1ccccc1C(=O)[O-].CC(=O)Oc1ccccc1C(=O)[O-].CC(=O)Oc1ccccc1C(=O)[O-].[Cu+2].[Cu+2]

| InChI = 1/4C9H8O4.2Cu/c4*1-6(10)13-8-5-3-2-4-7(8)9(11)12;;/h4*2-5H,1H3,(H,11,12);;/q;;;;2*+2/p-4

| InChIKey = BXBJCCCIFADZBU-XBHQNQODAY

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/4C9H8O4.2Cu/c4*1-6(10)13-8-5-3-2-4-7(8)9(11)12;;/h4*2-5H,1H3,(H,11,12);;/q;;;;2*+2/p-4

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = BXBJCCCIFADZBU-UHFFFAOYSA-J

| RTECS =

| MeSHName =

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI =

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG =

| SMILES1 = CC(=O)Oc0ccccc0[C-](O[Cu+2]123)O[Cu+2](O[C-](O1)c0ccccc0OC(=O)C)(O[C-](O2)c0ccccc0OC(=O)C)O[C-](O3)c0ccccc0OC(=O)C

}}

| Section2 = {{Chembox Properties

| Formula = C36H28Cu2O16

| MolarMass = 843.69g/mol

| Appearance = Bright blue crystalline solid.

| Density =

| MeltingPtC = 248 to 255

| MeltingPt_notes = (decomposes)

| BoilingPt =

| BoilingPt_notes =

| Solubility =

| SolubleOther =

| Solvent =

| pKa =

| pKb = }}

| Section3 = {{Chembox Structure

| CrystalStruct =

| Coordination =

| MolShape = }}

| Section4 = {{Chembox Thermochemistry

| DeltaHf =

| DeltaHc =

| Entropy =

| HeatCapacity = }}

| Section5 = {{Chembox Pharmacology

| AdminRoutes =

| Bioavail =

| Metabolism =

| HalfLife = 8.67 h (Human)[Ref#2]

| ProteinBound =

| Excretion =

| Legal_status =

| Legal_US =

| Legal_UK =

| Legal_AU =

| Legal_CA =

| Pregnancy_category =

| Pregnancy_AU =

}}

| Section6 = {{Chembox Explosive

| ShockSens =

| FrictionSens =

| DetonationV =

| REFactor = }}

| Section7 = {{Chembox Hazards

| MainHazards =

| NFPA-H =

| NFPA-F =

| NFPA-R =

| NFPA-S =

| FlashPt =

| AutoignitionPt =

| ExploLimits =

| PEL = TWA 1 mg/m3 (as Cu){{PGCH|0150}}

| REL = TWA 1 mg/m3 (as Cu)

| IDLH = TWA 100 mg/m3 (as Cu)

}}

| Section8 = {{Chembox Related

| OtherAnions =

| OtherCations = Zinc aspirinate, Aluminium aspirinate

| OtherFunction =

| OtherFunction_label =

| OtherCompounds = Aspirin}}

}}

Copper(II) aspirinate is an aspirin chelate of copper(II) cations (Cu2+). It is used to treat rheumatoid arthritis.

File:CopperAspirinate.jpg

Preparation

Copper aspirinate can be prepared by several methods. In one route of preparation, an excess of acetylsalicylic acid is dissolved in aqueous sodium carbonate. Sodium hydroxide is not suitable for this purpose, because it will hydrolyse acetylsalicylic acid (ASA) into salicylic acid and sodium acetate.

::2 HC9H7O4 + Na2CO3 → 2 NaC9H7O4 + CO2↑ + H2O

The resulting solution is then filtered to remove any undissolved acetylsalicylic acid and is mixed with a solution containing Cu2+ cations (copper(II) sulfate is suitable), precipitating bright blue crystals of copper aspirinate immediately. The crystals can then be filtered from solution, washed, and dried. An excess of acetylsalicylic acid is used in the first step, because it eliminates the possibility of unreacted carbonate anions precipitating the copper in this step.

::4 NaC9H7O4 + 2 CuSO4 → C36H28Cu2O16↓ + 2 Na2SO4

Medicinal use

Copper aspirinate has been proven effective as a treatment for rheumatoid arthritis.{{cite web | title = Rheumatoid Arthritis (RA) | publisher = Copper Development Association | date = June 2000 | url = http://www.copper.org/innovations/2000/06/medicine-chest.html | access-date = 2007-03-05 | archive-url = https://web.archive.org/web/20070202230851/http://www.copper.org/innovations/2000/06/medicine-chest.html | archive-date = 2007-02-02 | url-status = dead }} A pharmacokinetic study in healthy human volunteers supports its enhanced efficacy as compared with aspirin.MS Iqbal, M Sher, H Pervez & M Saeed (2008). "Pharmacokinetic Study of Copper (II) Acetylsalicylate" Biol. Trace Elem. Res. 124:283–288. doi:10.1007/s12011-008-8146-3

The studies on animal models suggest that copper aspirinate is very promising in treating against thrombotic diseases and it has all the prospects of success in becoming an antithrombotic drug that prevents and treats thrombotic diseases in humans.{{cite journal |title = Potential Application of Copper Aspirinate in Preventing and Treating Thromboembolic Diseases |journal = Metal-Based Drugs|year = 1998 |volume = 5 |issue = 3 |pages = 123–126 |doi = 10.1155/MBD.1998.123 |author = Weiping Liu,corresponding author1 Huizhou Xiong, Yikun Yang Ling Li, Zhiqiang Shen, and Zhihe Chen |pmid = 18475833 |pmc = 2365110 |doi-access = free}}

Other uses

The use of copper aspirinate as a pigment in PVC and polystyrene has also been investigated.{{cite journal | last = Allan | first = J R |author2=A Renton |author3=W E Smith |author4=D L Gerrard |author5=J Birnie | title = A Study of the Performance of Bis(acetylsalicylate) Copper(II) and the Cobalt(II), Nickel(II) and Copper(II) Complexes of Pyridine-3,4-dicarboxylic Acid as Colouring Materials for Poly(vinyl chloride) and Polystyrene | journal = Eur. Polym. J. | volume = 27 | issue = 7 | pages = 669–672 | year = 1991 | doi = 10.1016/0014-3057(91)90155-H | bibcode = 1991EurPJ..27..669A }}

Footnotes

{{reflist}}

{{salicylates}}

{{DEFAULTSORT:Copper Aspirinate}}

Category:Copper(II) compounds

Category:Acetylsalicylic acids

Category:Salicylates