:Cotriptyline

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 1-(10,11-Dihydro-5H-dibenzo[a,d][7]annulen-5-ylidene)-3-(dimethylamino)propan-2-one

| image = Cotriptyline.png

| alt = Skeletal formula of cotriptyline

| width = 180

| image2 = Cotriptyline-3D-balls.png

| alt2 = Ball-and-stick model of the cotriptyline molecule

| tradename =

| pregnancy_category =

| legal_status = Uncontrolled

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 34662-67-4

| ATC_prefix = none

| ATC_suffix =

| PubChem = 71935

| ChEMBL = 2106088

| ChemSpiderID = 64945

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = KQJ4QI511C

| C=20 | H=21 | N=1 | O=1

| smiles = O=C(/C=C2/c1c(cccc1)CCc3c2cccc3)CN(C)C

}}

Cotriptyline (SD-2203-01) is a tricyclic antidepressant (TCA) which was never marketed.{{cite book | vauthors = Triggle DJ | title = Dictionary of Pharmacological Agents | publisher = Chapman & Hall/CRC | location = Boca Raton | year = 1996 | isbn = 0-412-46630-9 | url = https://books.google.com/books?id=DeX7jgInYFMC&q=cotriptyline&pg=PA522}}