:Cryptopine

{{Chembox

| ImageFile = Cryptopin.svg

| ImageSize = 250px

| ImageFile1 = File:Cryptopin.png

| ImageSize1 = 250px

| PIN = 9,10-Dimethoxy-5-methyl-4,6,7,13-tetrahydro-2H-benzo[e][1,3]dioxolo[4,5-l][2]benzazecin-12(5H)-one

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 482-74-6

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = MW13X5YK4A

| PubChem = 72616

| ChemSpiderID = 65491

| ChEMBL = 1339015

| SMILES = CN1CCc2cc(c(cc2C(=O)Cc3ccc4c(c3C1)OCO4)OC)OC

| InChI = 1/C21H23NO5/c1-22-7-6-14-9-19(24-2)20(25-3)10-15(14)17(23)8-13-4-5-18-21(16(13)11-22)27-12-26-18/h4-5,9-10H,6-8,11-12H2,1-3H3

| InChIKey = XPOJSWHIKCNLEQ-UHFFFAOYAD

| StdInChI = 1S/C21H23NO5/c1-22-7-6-14-9-19(24-2)20(25-3)10-15(14)17(23)8-13-4-5-18-21(16(13)11-22)27-12-26-18/h4-5,9-10H,6-8,11-12H2,1-3H3

| StdInChIKey = XPOJSWHIKCNLEQ-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| Formula = C₂₁H₂₃NO₅

| MolarMass = 369.411

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Cryptopine is an opium alkaloid. It is found in plants in the family Papaveraceae, including Argemone mexicana.{{Cite journal| doi = 10.1590/S0102-695X2013005000021| issn = 0102-695X| volume = 23| issue = 3| pages = 559–575| last1 = Brahmachari| first1 = Goutam| last2 = Gorai| first2 = Dilip| last3 = Roy| first3 = Rajiv| title = Argemone mexicana: Chemical and pharmacological aspects| journal = Revista Brasileira de Farmacognosia| date = 2013-05-01| doi-access = free}}{{Cite journal| issn = 0007-523X| volume = 32| issue = 2| pages = 49–63| last1 = Ramanathan| first1 = V. S.| last2 = Chandra| first2 = P.| title = Recovery of thebaine and cryptopine from Indian opium| journal = Bulletin on Narcotics| date = 1980| pmid = 6907026}}