:Cryptopine
{{Chembox
| ImageFile = Cryptopin.svg
| ImageSize = 250px
| ImageFile1 = File:Cryptopin.png
| ImageSize1 = 250px
| PIN = 9,10-Dimethoxy-5-methyl-4,6,7,13-tetrahydro-2H-benzo[e][1,3]dioxolo[4,5-l][2]benzazecin-12(5H)-one
| OtherNames =
|Section1={{Chembox Identifiers
| CASNo = 482-74-6
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = MW13X5YK4A
| PubChem = 72616
| ChemSpiderID = 65491
| ChEMBL = 1339015
| SMILES = CN1CCc2cc(c(cc2C(=O)Cc3ccc4c(c3C1)OCO4)OC)OC
| InChI = 1/C21H23NO5/c1-22-7-6-14-9-19(24-2)20(25-3)10-15(14)17(23)8-13-4-5-18-21(16(13)11-22)27-12-26-18/h4-5,9-10H,6-8,11-12H2,1-3H3
| InChIKey = XPOJSWHIKCNLEQ-UHFFFAOYAD
| StdInChI = 1S/C21H23NO5/c1-22-7-6-14-9-19(24-2)20(25-3)10-15(14)17(23)8-13-4-5-18-21(16(13)11-22)27-12-26-18/h4-5,9-10H,6-8,11-12H2,1-3H3
| StdInChIKey = XPOJSWHIKCNLEQ-UHFFFAOYSA-N
}}
|Section2={{Chembox Properties
| Formula = C21H23NO5
| MolarMass = 369.411
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Cryptopine is an opium alkaloid. It is found in plants in the family Papaveraceae, including Argemone mexicana.{{Cite journal| doi = 10.1590/S0102-695X2013005000021| issn = 0102-695X| volume = 23| issue = 3| pages = 559–575| last1 = Brahmachari| first1 = Goutam| last2 = Gorai| first2 = Dilip| last3 = Roy| first3 = Rajiv| title = Argemone mexicana: Chemical and pharmacological aspects| journal = Revista Brasileira de Farmacognosia| date = 2013-05-01| doi-access = free}}{{Cite journal| issn = 0007-523X| volume = 32| issue = 2| pages = 49–63| last1 = Ramanathan| first1 = V. S.| last2 = Chandra| first2 = P.| title = Recovery of thebaine and cryptopine from Indian opium| journal = Bulletin on Narcotics| date = 1980| pmid = 6907026}}
See also
References
{{reflist}}
{{alkaloid-stub}}
{{heterocyclic-stub}}
{{Components of Opium}}
Category:Natural opium alkaloids