:Cucurbitacin D

{{Chembox

| ImageFile = Cucurbitacin D.svg

| ImageSize = 200px

| ImageAlt =

| IUPACName = (23E)-2β,16α,20,25-Tetrahydroxy-9-methyl-19-nor-9β,10α-lanosta-5,23-diene-3,11,22-trione

| SystematicName = (1R,2R,3aS,3bS,8S,9aR,9bR,11aR)-1-[(2R,4E)-2,6-Dihydroxy-6-methyl-3-oxohept-4-en-2-yl]-2,8-dihydroxy-3a,6,6,9b,11a-pentamethyl-2,3,3a,3b,4,6,8,9,9a,9b,11,11a-dodecahydro-1H-cyclopenta[a]phenanthrene-7,10-dione

| OtherNames = Elatericin A

|Section1={{Chembox Identifiers

| CASNo = 3877-86-9

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 5I62H4ORC7

| ChEMBL = 493646

| PubChem = 5281318

| ChemSpiderID = 4444695

| SMILES = C[C@@]12C[C@H]([C@@H]([C@]1(CC(=O)[C@@]3([C@H]2CC=C4[C@H]3C[C@@H](C(=O)C4(C)C)O)C)C)[C@](C)(C(=O)/C=C/C(C)(C)O)O)O

| InChI = 1/C30H44O7/c1-25(2,36)12-11-21(33)30(8,37)23-19(32)14-27(5)20-10-9-16-17(13-18(31)24(35)26(16,3)4)29(20,7)22(34)15-28(23,27)6/h9,11-12,17-20,23,31-32,36-37H,10,13-15H2,1-8H3/b12-11+/t17-,18+,19-,20+,23+,27+,28-,29+,30+/m1/s1

| InChIKey = SRPHMISUTWFFKJ-QJNWWGCFBO

| StdInChI = 1S/C30H44O7/c1-25(2,36)12-11-21(33)30(8,37)23-19(32)14-27(5)20-10-9-16-17(13-18(31)24(35)26(16,3)4)29(20,7)22(34)15-28(23,27)6/h9,11-12,17-20,23,31-32,36-37H,10,13-15H2,1-8H3/b12-11+/t17-,18+,19-,20+,23+,27+,28-,29+,30+/m1/s1

| StdInChIKey = SRPHMISUTWFFKJ-QJNWWGCFSA-N}}

|Section2={{Chembox Properties

| C = 30 | H = 44 | O = 7

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Cucurbitacin D is a plant triterpene first identified in plants in the family Cucurbitaceae.{{cite journal | doi = 10.1002/jsfa.2740050904 | title = Bitter principles of the cucurbitaceae. I.—Observations on the chemistry of cucurbitacin A | year = 1954 | last1 = Enslin | first1 = P. R. | journal = Journal of the Science of Food and Agriculture | volume = 5 | issue = 9 | pages = 410–416 }}{{cite journal | doi = 10.1021/ja01536a047 | title = The Constituents of Ecballium elaterium L. III. Elatericin a and B^1,2 | year = 1958 | last1 = Lavie | first1 = David | last2 = Willner | first2 = David | journal = Journal of the American Chemical Society | volume = 80 | issue = 3 | pages = 710–714 }} In preliminary in vitro studies, it has shown inhibitory properties against endometrial and ovarian cancer cell lines.{{cite journal | doi = 10.1007/s13277-012-0549-2 | pmid = 23150173 | title = Cucurbitacin D induces growth inhibition, cell cycle arrest, and apoptosis in human endometrial and ovarian cancer cells | year = 2013 | last1 = Ishii | first1 = Terukazu | last2 = Kira | first2 = Naoko | last3 = Yoshida | first3 = Toshie | last4 = Narahara | first4 = Hisashi | journal = Tumor Biology | volume = 34 | issue = 1 | pages = 285–291 | s2cid = 16889635 }}