:Cyclanoline

{{refimprove|date=May 2021}}

{{Chembox

| ImageFile = Cyclanoline.svg

| ImageSize =

| ImageAlt =

| IUPACName =

| OtherNames = Cissamine

|Section1={{Chembox Identifiers

| CASNo = 18556-27-9

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 77QC59KBD2

| PubChem = 3082134

| ChEBI = 76923

| ChemSpiderID = 2339606

| SMILES = COc1ccc2C[C@H]3c4cc(O)c(OC)cc4CC[N@@+]3(C)Cc2c1O

| StdInChI = 1S/C20H23NO4/c1-21-7-6-13-9-19(25-3)17(22)10-14(13)16(21)8-12-4-5-18(24-2)20(23)15(12)11-21/h4-5,9-10,16H,6-8,11H2,1-3H3,(H-,22,23)/p+1/t16-,21-/m0/s1

| StdInChIKey = LKLWVKCEYSPQHL-KKSFZXQISA-O }}

|Section2={{Chembox Properties

| C=20 | H=23 | N=1 | O=4 | Formula_Charge=+

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Cyclanoline is an acetylcholinesterase inhibitor isolated from Stephania venosa tuber.{{cite journal |doi=10.1211/jpp.58.5.0015 |title=Acetylcholinesterase inhibitors from Stephania venosa tuber |year=2006 |last1=Ingkaninan |first1=Kornkanok |last2=Phengpa |first2=Preeda |last3=Yuenyongsawad |first3=Supreeya |last4=Khorana |first4=Nantaka |journal=Journal of Pharmacy and Pharmacology |volume=58 |issue=5 |pages=695–700 |pmid=16640839 |s2cid=25176455 |doi-access=free }}