:Cyfluthrin
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 449713431
| ImageFile1 = Cyfluthrin Marco 201809017.svg
| ImageFile2 = Cyfluthrin 3D.png
| PIN = (R)-Cyano(4-fluoro-3-phenoxyphenyl)methyl (1R,3R)-3-(2,2-dichloroethen-1-yl)-2,2-dimethylcyclopropane-1-carboxylate
| OtherNames =
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 45482
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = SCM2QLZ6S0
| InChI = 1/C22H18Cl2FNO3/c1-22(2)15(11-19(23)24)20(22)21(27)29-18(12-26)13-8-9-16(25)17(10-13)28-14-6-4-3-5-7-14/h3-11,15,18,20H,1-2H3/t15-,18-,20-/m0/s1
| InChIKey = QQODLKZGRKWIFG-QSFXBCCZBF
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C22H18Cl2FNO3/c1-22(2)15(11-19(23)24)20(22)21(27)29-18(12-26)13-8-9-16(25)17(10-13)28-14-6-4-3-5-7-14/h3-11,15,18,20H,1-2H3/t15-,18-,20-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = QQODLKZGRKWIFG-QSFXBCCZSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 68359-37-5
| PubChem = 50153
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 2104608
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C10982
| SMILES = Cl/C(Cl)=C/[C@H]3[C@@H](C(=O)O[C@@H](C#N)c2ccc(F)c(Oc1ccccc1)c2)C3(C)C
}}
|Section2={{Chembox Properties
| C=22 | H=18 | Cl=2 | F=1 | N=1 | O=3
| Appearance =
| Density =
| MeltingPtC = 60
| BoilingPt =
| Solubility = 2 μg/L}}
|Section6={{Chembox Pharmacology
| ATCCode_prefix = P03
| ATCCode_suffix = BA01
| ATC_Supplemental = {{ATCvet|P53|AC12}}
}}
|Section7={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}
Cyfluthrin is a pyrethroid insecticide and common household pesticide. It is a complex organic compound and the commercial product is sold as a mixture of isomers. Like most pyrethroids (MoA 3a), it is highly toxic to fish and invertebrates, but it is far less toxic to humans. It is generally supplied as a 10–25% liquid concentrate for commercial use and is diluted prior to spraying onto agricultural crops and outbuildings.
Safety
In rats, the {{LD50}}s are 500, 800 (oral), and 600 (skin) mg/kg.{{cite book | author = Robert L. Metcalf | chapter = Insect Control | title = Ullmann's Encyclopedia of Industrial Chemistry | publisher = Wiley-VCH | location = Weinheim | year = 2002 | doi = 10.1002/14356007.a14_263| isbn = 9783527303854 }}
Excessive exposure can cause nausea, headache, muscle weakness, salivation, shortness of breath and seizures. In humans, it is deactivated by enzymatic hydrolysis to several carboxylic acid metabolites, whose urinary excretion half-lives are in a range of 5–7 hours. Worker exposure to the chemical can be monitored by measurement of the urinary metabolites, while severe overdosage may be confirmed by quantification of cyfluthrin in blood or plasma.{{Cite book|author = R. Baselt | title = Disposition of Toxic Drugs and Chemicals in Man | edition = 8th | publisher = Biomedical Publications | location = Foster City, CA | year = 2008 | pages = 388–389}}
Health and safety risks are controlled by right to know laws that exist in most developed countries. Cyfluthrin is regulated in the US by the EPA.{{cite web|url=http://www.epa.gov/oppsrrd1/reevaluation/pyrethroids-pyrethrins.html|title=Pyrethroids and Pyrethrins|publisher=United States Environmental Protection Agency}}
See also
References
{{reflist|refs=
{{cite web|url=http://irac-online.org/documents/moa-classification/|title=IRAC Mode of Action Classification Scheme Version 9.4|website=IRAC (Insecticide Resistance Action Committee)|type=pdf|date=March 2020}}
}}
{{insecticides}}
Category:(cyano-(3-phenoxyphenyl)methyl) 2,2,3-trimethylcyclopropane-1-carboxylates