:Cyphenothrin

{{Chembox

| ImageFile = Cyphenothrin.svg

| ImageSize = 200px

| IUPACName = Cyano(3-phenoxyphenyl)methyl 2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropanecarboxylate

| OtherNames = (±)-α-Cyano-3-phenoxybenzyl (±)-cis/trans-chrysanthemate

|Section1={{Chembox Identifiers

| CASNo = 39515-40-7

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = S0IU5Y1R32

| PubChem = 38283

| ChemSpiderID = 35087

| SMILES = N#CC(OC(=O)C1C(/C=C(/C)C)C1(C)C)c3cccc(Oc2ccccc2)c3

| InChI = 1/C24H25NO3/c1-16(2)13-20-22(24(20,3)4)23(26)28-21(15-25)17-9-8-12-19(14-17)27-18-10-6-5-7-11-18/h5-14,20-22H,1-4H3

| InChIKey = FJDPATXIBIBRIM-UHFFFAOYAC

| StdInChI = 1S/C24H25NO3/c1-16(2)13-20-22(24(20,3)4)23(26)28-21(15-25)17-9-8-12-19(14-17)27-18-10-6-5-7-11-18/h5-14,20-22H,1-4H3

| StdInChIKey = FJDPATXIBIBRIM-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=24 | H=25 | N=1 | O=3

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Cyphenothrin is a synthetic pyrethroid insecticide. It is effective against cockroaches that have developed resistance to organophosphorous and carbamate insecticides.{{cite journal | pmid = 16161703 | year = 2005 | last1 = Tilak | first1 = R | last2 = Agrawal | first2 = VK | last3 = Dutta | first3 = J | title = Field performance of cyphenothrin: An integrated insecticide strategy against German cockroaches (Dictyoptera: Blatellidae) | volume = 42 | issue = 2 | pages = 68–73 | journal = Journal of Vector Borne Diseases}}