:DHA-paclitaxel
{{short description|Investigational drug}}
{{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 376090820
| ImageFile = Taxoprexin.png
| ImageSize = 200px
| ImageAlt =
| IUPACName = 1,7β-Dihydroxy-9-oxo-5β,20-epoxytax-11-ene-2α,4α,10β,13α-tetrayl 4,10-diacetate 13-[(2R,3S)-3-benzamido-2-{[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxy}-3-phenylpropanoate] 2-benzoate
| SystematicName = (2aR,4S,4aS,6R,9S,11S,12S,12aR,12bS)-4,11-Dihydroxy-4a,8,13,13-tetramethyl-5-oxo-2a,3,4,4a,5,6,9,10,11,12,12a,12b-dodecahydro-1H-7,11-methano[1]benzoxeto[3,4-a][10]annulene-6,9,12,12b-tetrayl 6,12b-diacetate 9-[(2R,3S)-3-benzamido-2-{[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxy}-3-phenylpropanoate] 12-benzoate
| OtherNames = Docosahexaenoyl-paclitaxel; Taxoprexin
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 199796-52-6
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = OJE5810C4F
| PubChem = 6918473
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 5293670
| SMILES = O=C(c1ccccc1)N[C@@H](c2ccccc2)[C@@H](OC(=O)CC\C=C/C\C=C/C\C=C/C\C=C/C\C=C/C\C=C/CC)C(=O)O[C@@H]5C(=C4/[C@@H](OC(=O)C)C(=O)[C@]7([C@H]([C@H](OC(=O)c3ccccc3)[C@@](O)(C4(C)C)C5)[C@@]6(OC(=O)C)[C@H](OC6)C[C@@H]7O)C)/C
| InChI = 1/C69H81NO15/c1-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-35-42-55(74)83-59(57(49-36-29-26-30-37-49)70-63(76)50-38-31-27-32-39-50)65(78)82-52-44-69(79)62(84-64(77)51-40-33-28-34-41-51)60-67(7,53(73)43-54-68(60,45-80-54)85-48(4)72)61(75)58(81-47(3)71)56(46(52)2)66(69,5)6/h9-10,12-13,15-16,18-19,21-22,24-34,36-41,52-54,57-60,62,73,79H,8,11,14,17,20,23,35,42-45H2,1-7H3,(H,70,76)/b10-9-,13-12-,16-15-,19-18-,22-21-,25-24-/t52-,53-,54+,57-,58+,59+,60-,62-,67+,68-,69+/m0/s1
| InChIKey = LRCZQSDQZJBHAF-PUBGEWHCBO
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C69H81NO15/c1-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-35-42-55(74)83-59(57(49-36-29-26-30-37-49)70-63(76)50-38-31-27-32-39-50)65(78)82-52-44-69(79)62(84-64(77)51-40-33-28-34-41-51)60-67(7,53(73)43-54-68(60,45-80-54)85-48(4)72)61(75)58(81-47(3)71)56(46(52)2)66(69,5)6/h9-10,12-13,15-16,18-19,21-22,24-34,36-41,52-54,57-60,62,73,79H,8,11,14,17,20,23,35,42-45H2,1-7H3,(H,70,76)/b10-9-,13-12-,16-15-,19-18-,22-21-,25-24-/t52-,53-,54+,57-,58+,59+,60-,62-,67+,68-,69+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = LRCZQSDQZJBHAF-PUBGEWHCSA-N}}
|Section2={{Chembox Properties
| C=69 | H=81 | N=1 | O=15
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
|Section5={{Chembox Pharmacology
| AdminRoutes =
| Bioavail =
| Metabolism =
| HalfLife =
| ProteinBound =
| Excretion =
| Legal_status =
| Legal_US =
| Legal_UK =
| Legal_AU =
| Legal_CA =
| PregCat =
| PregCat_AU =
| PregCat_US = }}
}}
DHA-paclitaxel (or Taxoprexin) is an investigational drug (from Protarga Inc) made by linking paclitaxel to docosahexaenoic acid (DHA), a fatty acid that is easily taken up by tumor cells; the DHA-paclitaxel “appears not to be cytotoxic until the bond with DHA is cleaved within the cell.”{{Cite journal | author = Whelan, Jo | journal = Drug Discovery Today | volume = 7 | issue =2 | year = 2002 | pages = 90–92 | doi = 10.1016/S1359-6446(01)02149-3 | pmid = 11790612 | title = Targeted taxane therapy for cancer}} The advantage of DHA-paclitaxel over paclitaxel is DHA-paclitaxel's ability to carry much higher concentrations of paclitaxel to the cells, which are maintained for longer periods in the tumor cells, thus increasing their action. With increased activity, DHA-paclitaxel, also known as Taxoprexin, may have a more successful response in cancer patients than Taxol, and it may be able to treat more types of cancer than Taxol has been able to treat.
Clinical trials
In 2007, a phase II clinical trial reported "modest activity in patients with oesophago-gastric cancer".{{cite journal | pmid = 17440725 | year = 2008 | last1 = Jones | first1 = RJ | last2 = Hawkins | first2 = RE | last3 = Eatock | first3 = MM | last4 = Ferry | first4 = DR | last5 = Eskens | first5 = FA | last6 = Wilke | first6 = H | last7 = Evans | first7 = TR | title = A phase II open-label study of DHA-paclitaxel (Taxoprexin) by 2-h intravenous infusion in previously untreated patients with locally advanced or metastatic gastric or oesophageal adenocarcinoma | volume = 61 | issue = 3 | pages = 435–41 | doi = 10.1007/s00280-007-0486-8 | journal = Cancer Chemotherapy and Pharmacology}}