:Danielone

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 428385498

| Name = Danielone

| ImageFile = Danielone.svg

| ImageSize = 200px

| ImageName = Chemical structure of danielone

| ImageAlt = Chemical structure of danielone

| PIN = 2-Hydroxy-1-(4-hydroxy-3,5-dimethoxyphenyl)ethan-1-one

| OtherNames = {{ubl|α-Hydroxyacetosyringone | 3',5'-Dimethoxy-4'-hydroxy-(2-hydroxy)acetophenone}}

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 90426-22-5

| CASNoOther =

| PubChem = 146167

| SMILES = COC1=CC(=CC(=C1O)OC)C(=O)CO

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 128934

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 4316

| InChI = 1/C10H12O5/c1-14-8-3-6(7(12)5-11)4-9(15-2)10(8)13/h3-4,11,13H,5H2,1-2H3

| InChIKey = ZTBAPEIDNUHRNC-UHFFFAOYAI

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C10H12O5/c1-14-8-3-6(7(12)5-11)4-9(15-2)10(8)13/h3-4,11,13H,5H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = ZTBAPEIDNUHRNC-UHFFFAOYSA-N

| MeSHName =

}}

|Section2={{Chembox Properties

| C=10 | H=12 | O=5

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

| GHS_ref =

}}

}}

Danielone is a phytoalexin found in the papaya fruit. This compound showed high antifungal activity against Colletotrichum gloesporioides, a pathogenic fungus of papaya.{{Cite journal | pmid = 9004541| year = 1997| last1 = Echeverri| first1 = F.| title = Danielone, a phytoalexin from papaya fruit| journal = Phytochemistry| volume = 44| issue = 2| pages = 255–6| last2 = Torres| first2 = F.| last3 = Quiñones| first3 = W.| last4 = Cardona| first4 = G.| last5 = Archbold| first5 = R.| last6 = Roldan| first6 = J.| last7 = Brito| first7 = I.| last8 = Luis| first8 = J. G.| last9 = Lahlou| first9 = E. H.| doi=10.1016/s0031-9422(96)00418-9| bibcode = 1997PChem..44..255E}} A laboratory synthesis of danielone has been reported.{{Cite journal | doi = 10.1039/A808061E| title = Synthesis of Danielone (α-Hydroxyacetosyringone)| journal = Journal of Chemical Research| issue = 3| pages = 220–221| year = 1999| last1 = Luis| first1 = Javier G.| last2 = Andrés| first2 = Lucía S.}}