:Dehydrohexahydroxydiphenic acid

{{chembox

| ImageFile = DHHDP.PNG

| ImageSize = 200px

| IUPACName = 5,6,9,13,13-pentahydroxy-10-oxo-8-oxatricyclo[7.3.1.02,7]trideca-2,4,6,11-tetraene-3,12-dicarboxylic acid

| OtherNames = Dehydrohexahydroxydiphenoyl
DHHDP

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref =

| ChemSpiderID =

| ChEMBL_Ref =

| ChEMBL =

| CASNo_Ref =

| CASNo =

| PubChem = 139031016

| StdInChI=1S/C14H10O11/c15-5-1-3(11(18)19)7-8-4(12(20)21)2-6(16)14(24,13(8,22)23)25-10(7)9(5)17/h1-2,8,15,17,22-24H,(H,18,19)(H,20,21)

| StdInChIKey = ZMIDWLVYIBGXNC-UHFFFAOYSA-N

| SMILES = C1=C(C2C3=C(C(=C(C=C3C(=O)O)O)O)OC(C1=O)(C2(O)O)O)C(=O)O

}}

|Section2={{Chembox Properties

| Formula = C₁₄H₁₀O₁₁

| MolarMass = 354.22 g/mol

| Appearance =

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Dehydrohexahydroxydiphenic acid is a group found in dehydroellagitannins. It is formed from hexahydroxydiphenic acid (HHDP) through oxidation of the plant hydrolysable tannins.Correlation of oxidative transformations of hydrolyzable tannins and plant evolution. Takashi Yoshida and Tsutomu Hatano, Phytochemistry, November 2000, Volume 55, Issue 6, Pages 513–529, {{doi|10.1016/S0031-9422(00)00232-6}} It is found in ellagitannins such as euphorbin A, geraniin or mallotusinic acid.

In geraniin, it is forming an equilibrium mixture of six-membered hemi-ketal and five-membered hemi-ketal forms.{{Citation needed|date=December 2019|reason=removed citation to predatory publisher content}}