:Deoxyadenosine diphosphate
{{short description|Chemical compound}}
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 447288226
| ImageFile=Desoxyadenosindiphosphat protoniert.svg
| ImageSize=220
| ImageAlt = Skeletal formula of adenosine diphosphate
| ImageFile1 = Deoxyadenosine-diphosphate-anion-3D-balls.png
| ImageSize1 = 220
| ImageAlt1 = Ball-and-stick model of the adenosine diphosphate anion
| IUPACName=2′-Deoxyadenosine 5′-(trihydrogen diphosphate)
| SystematicName=[(2R,3S,5R)-5-(6-Amino-9H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl trihydrogen diphosphate
| OtherNames=dADP
| Reference=[https://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=620 dADP - Compound Summary], PubChem.
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo=2793-06-8
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = APQ916I0QD
| MeSHName=Deoxyadenosine+diphosphate
| PubChem = 188966
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 164196
| SMILES = C1[C@@H]([C@H](O[C@H]1N2C=NC3=C(N=CN=C32)N)COP(=O)(O)OP(=O)(O)O)O
| InChI = 1/C10H15N5O9P2/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(23-7)2-22-26(20,21)24-25(17,18)19/h3-7,16H,1-2H2,(H,20,21)(H2,11,12,13)(H2,17,18,19)/t5-,6+,7+/m0/s1
| InChIKey = DAEAPNUQQAICNR-RRKCRQDMBL
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C10H15N5O9P2/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(23-7)2-22-26(20,21)24-25(17,18)19/h3-7,16H,1-2H2,(H,20,21)(H2,11,12,13)(H2,17,18,19)/t5-,6+,7+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = DAEAPNUQQAICNR-RRKCRQDMSA-N
}}
|Section2={{Chembox Properties
| Formula=C10H15N5O9P2
| MolarMass=411.201722
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
}}
}}
Deoxyadenosine diphosphate is a nucleoside diphosphate. It is related to the common nucleic acid ATP, or adenosine triphosphate, with the -OH (hydroxyl) group on the 2' carbon on the nucleotide's pentose removed (hence the deoxy- part of the name), and with one fewer phosphoryl group than ATP. This makes it also similar to adenosine diphosphate except with a hydroxyl group removed.
Deoxyadenosine diphosphate is abbreviated dADP.
See also
References
{{reflist}}
{{Nucleobases, nucleosides, and nucleotides}}