:Deoxyadenosine monophosphate
{{Chembox
| verifiedrevid = 447288275
| ImageFile= Desoxyadenosinmonophosphat protoniert.svg
| ImageAlt = Skeletal formula of deoxyadenosine monophosphate
| ImageFile1 = Deoxyadenosine-monophosphate-anion-3D-balls.png
| ImageSize1 = 220
| ImageAlt1 = Ball-and-stick model of the deoxyadenosine monophosphate anion
| IUPACName=2′-Deoxyadenylic acid
| SystematicName=[(2R,3S,5R)-5-(6-Amino-9H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate
| OtherNames=
|Section1={{Chembox Identifiers
| IUPHAR_ligand = 5120
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 12079
| InChI = 1/C10H14N5O6P/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(21-7)2-20-22(17,18)19/h3-7,16H,1-2H2,(H2,11,12,13)(H2,17,18,19)/t5-,6+,7+/m0/s1
| InChIKey = KHWCHTKSEGGWEX-RRKCRQDMBS
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C10H14N5O6P/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(21-7)2-20-22(17,18)19/h3-7,16H,1-2H2,(H2,11,12,13)(H2,17,18,19)/t5-,6+,7+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = KHWCHTKSEGGWEX-RRKCRQDMSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=653-63-4
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = VFR8I97ORM
| PubChem=621
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 17713
| SMILES = c1nc(c2c(n1)n(cn2)[C@H]3C[C@@H]([C@H](O3)COP(=O)(O)O)O)N
| MeSHName=Deoxyadenosine+monophosphate
}}
|Section2={{Chembox Properties
| Formula=C10H14N5O6P
| MolarMass=331.222 g/mol
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
}}
}}
Deoxyadenosine monophosphate (dAMP), also known as deoxyadenylic acid or deoxyadenylate in its conjugate acid and conjugate base forms, respectively, is a derivative of the common nucleotide adenosine monophosphate (AMP), in which the -OH (hydroxyl) group on the 2' carbon on the nucleotide's pentose has been reduced to just a hydrogen atom (hence the "deoxy-" part of the name). Deoxyadenosine monophosphate is abbreviated dAMP. It is a monomer used in DNA.
See also
Sources
- {{cite HMDB|author1-link=David S. Wishart|url=http://www.hmdb.ca/metabolites/HMDB00905|title=Showing metabocard for Deoxyadenosine monophosphate (HMDB0000905)}}
{{Nucleobases, nucleosides, and nucleotides}}
{{DEFAULTSORT:Deoxyadenosine Monophosphate}}
{{Biochemistry-stub}}