:Deoxyguanosine triphosphate
{{Chembox
| Verifiedfields = changed
| verifiedrevid = 440114883
| ImageFile=Desoxyguanosintriphosphat protoniert.svg
| ImageSize = 250
| ImageAlt = Skeletal formula of deoxyguanosine triphosphate
| ImageFile1 = Deoxyguanosine-triphosphate-anion-3D-spacefill.png
| ImageSize1 = 220
| ImageAlt1 = Space-filling model of the deoxyguanosine triphosphate anion
| IUPACName=2′-Deoxyguanosine 5′-(tetrahydrogen triphosphate)
| SystematicName=O1-
| OtherNames=
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 2564-35-4
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 8C2O37Y44Q
| PubChem = 65103
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 58613
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 477486
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 16497
| SMILES = O=P(O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n1cnc2c1NC(=N/C2=O)\N)C[C@@H]3O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI=1S/C10H16N5O13P3/c11-10-13-8-7(9(17)14-10)12-3-15(8)6-1-4(16)5(26-6)2-25-30(21,22)28-31(23,24)27-29(18,19)20/h3-6,16H,1-2H2,(H,21,22)(H,23,24)(H2,18,19,20)(H3,11,13,14,17)/t4-,5+,6+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = HAAZLUGHYHWQIW-KVQBGUIXSA-N
}}
|Section2={{Chembox Properties
| Formula=C10H16N5O13P3
| MolarMass=507.181023
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
}}
}}
Deoxyguanosine triphosphate{{Lehninger4th}} (dGTP) is a nucleoside triphosphate, and a nucleotide precursor used in cells for DNA synthesis. The substance is used in the polymerase chain reaction technique, in sequencing, and in cloning. It is also the competitor of inhibition onset by acyclovir in the treatment of HSV virus.{{cite journal |vauthors=Furman PA, Lambe CU, Nelson DJ |title=Effect of acyclovir on the deoxyribonucleoside triphosphate pool levels in Vero cells infected with herpes simplex virus type 1 |journal=Am. J. Med. |volume=73 |issue=1A |pages=14–7 |date=July 1982 |pmid=6285704 |doi= 10.1016/0002-9343(82)90056-0}}
References
{{reflist|2}}
{{Nucleobases, nucleosides, and nucleotides}}
{{DEFAULTSORT:Deoxyguanosine Triphosphate}}
{{Organic-compound-stub}}