:Derrubone

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 400628942

| ImageFile = Derrubone.svg

| IUPACName = 5,7-Dihydroxy-6-(3-methylbut-2-en-1-yl)-3′,4′-[methylenebis(oxy)]isoflavone

| SystematicName = 3-(2H-1,3-Benzodioxol-5-yl)-5,7-dihydroxy-6-(3-methylbut-2-en-1-yl)-4H-1-benzopyran-4-one

| OtherNames = 5,7-Dihydroxy-3',4'-methylenedioxy-6-prenylisoflavone

|Section1={{Chembox Identifiers

| Abbreviations =

| CASNo_Ref = {{cascite|changed|??}}

| CASNo =22044-58-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = EVN8G9T8C6

| EINECS =

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 412010

| PubChem = 5810067

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 4709237

| SMILES = CC(=CCC1=C(C=C2C(=C1O)C(=O)C(=CO2)C3=CC4=C(C=C3)OCO4)O)C

| InChI = 1/C21H18O6/c1-11(2)3-5-13-15(22)8-18-19(20(13)23)21(24)14(9-25-18)12-4-6-16-17(7-12)27-10-26-16/h3-4,6-9,22-23H,5,10H2,1-2H3

| InChIKey = FTBGFGQPUMCUSC-UHFFFAOYAI

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C21H18O6/c1-11(2)3-5-13-15(22)8-18-19(20(13)23)21(24)14(9-25-18)12-4-6-16-17(7-12)27-10-26-16/h3-4,6-9,22-23H,5,10H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = FTBGFGQPUMCUSC-UHFFFAOYSA-N

| RTECS =

| MeSHName =

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI =

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG =

}}

|Section2={{Chembox Properties

| C=21 | H=18 | O=6

| Appearance =

| Density =

| MeltingPt =

| MeltingPt_notes =

| BoilingPt =

| BoilingPt_notes =

| Solubility =

| SolubleOther =

| Solvent =

| pKa =

| pKb =

| IsoelectricPt =

| SpecRotation =

| RefractIndex =

| Viscosity =

| Dipole = }}

|Section3={{Chembox Structure

| CrystalStruct =

| Coordination =

| MolShape =

| Dipole = }}

|Section4={{Chembox Thermochemistry

| DeltaHf =

| DeltaHc =

| Entropy =

| HeatCapacity = }}

|Section5={{Chembox Pharmacology

| AdminRoutes =

| Bioavail =

| Metabolism =

| HalfLife =

| ProteinBound =

| Excretion =

| Legal_status =

| Legal_US =

| Legal_UK =

| Legal_AU =

| Legal_CA =

| Pregnancy_category =

| Pregnancy_AU =

| Pregnancy_US = }}

|Section6={{Chembox Explosive

| ShockSens =

| FrictionSens =

| DetonationV =

| REFactor = }}

|Section7={{Chembox Hazards

| ExternalSDS =

| MainHazards =

| NFPA-H =

| NFPA-F =

| NFPA-R =

| NFPA-S =

| FlashPt =

| AutoignitionPt =

| ExploLimits =

| PEL = }}

|Section8={{Chembox Related

| OtherAnions =

| OtherCations =

| OtherFunction =

| OtherFunction_label =

| OtherCompounds = }}

}}

Derrubone is a prenylated isoflavone, a type of flavonoid. It was originally isolated from the Indian tree Derris robusta.{{cite journal |vauthors=East AJ, Ollis WD, Wheeler RE |title=Natural occurrence of 3-aryl-4-hydroxycoumarins. Part I. Phytochemical examination of Derris robusta(roxb.) benth. |journal=J. Chem. Soc. C |volume=3 |pages=365–74 |year=1969 |issue=3 |doi=10.1039/J39690000365 |url=http://www.rsc.org/publishing/journals/J3/article.asp?doi=J39690000365|url-access=subscription }} Recent research indicates that it acts as an inhibitor of Hsp90 to its function as a chaperone protein.{{cite journal |vauthors=Hadden MK, Galam L, Gestwicki JE, Matts RL, Blagg BS |title=Derrubone, an inhibitor of the Hsp90 protein folding machinery |journal=J. Nat. Prod. |volume=70 |issue=12 |pages=2014–8 |date=December 2007 |pmid=18020309 |doi=10.1021/np070190s }}