:Diacetoxyscirpenol

{{chembox

| ImageFile= Diacetoxyscirpenol.svg

| ImageSize=200px

| IUPACName = 3α-Hydroxy-12α,13-epoxy-trichothec-9-ene-4β,15-diyl diacetate

| SystematicName = (2R,2′R,3R,4S,5S,5aR,9aR)-5a-[(Acetyloxy)methyl]-3-hydroxy-5,8-dimethyl-2,3,4,5,5a,6,7,9a-octahydrospiro[[2,5]methano[1]benzoxepine-10,2′-oxiran]-4-yl acetate

| OtherNames = anguidine

|Section1={{Chembox Identifiers

| ChemSpiderID = 82639

| SMILES = CC1=C[C@@H]2[C@](CC1)([C@]3([C@@H]([C@H]([C@H]([C@]34CO4)O2)O)OC(=O)C)C)COC(=O)C

| StdInChI = 1S/C19H26O7/c1-10-5-6-18(8-23-11(2)20)13(7-10)26-16-14(22)15(25-12(3)21)17(18,4)19(16)9-24-19/h7,13-16,22H,5-6,8-9H2,1-4H3/t13-,14-,15-,16-,17-,18-,19-/m1/s1

| StdInChIKey = AUGQEEXBDZWUJY-ZLJUKNTDSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo= 2270-40-8

| ChEMBL_Ref =

| ChEMBL =

| PubChem = 91518

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = UYL28I099N

| ChEBI_Ref =

| ChEBI =

}}

|Section2={{Chembox Properties

| C=19 | H=26 | O=7

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Diacetoxyscirpenol (DAS), also called anguidine, is a mycotoxin from the group of type A trichothecenes. It is a secondary metabolite product of fungi of the genus Fusarium and may cause toxicosis in farm animals.{{cite journal|vauthors=Hoerr FJ, Carlton WW, Yagen B |title=Mycotoxicosis caused by a single dose of T-2 toxin or diacetoxyscirpenol in broiler chickens|journal=Vet. Pathol.|year=1981|volume=18|issue=5|pages=652–664|doi=10.1177/030098588101800510|pmid=7281462|s2cid=22715425|doi-access=free}}

The US Health and Human Services agency considers it a select agent for research purposes.{{cite web|title=Select Agents and Toxins list|date=17 May 2024 |url=https://www.selectagents.gov/sat/list.htm}}

References

Category:Trichothecenes

{{Ether-stub}}