:Diacetoxyscirpenol
{{chembox
| ImageFile= Diacetoxyscirpenol.svg
| ImageSize=200px
| IUPACName = 3α-Hydroxy-12α,13-epoxy-trichothec-9-ene-4β,15-diyl diacetate
| SystematicName = (2R,2′R,3R,4S,5S,5aR,9aR)-5a-[(Acetyloxy)methyl]-3-hydroxy-5,8-dimethyl-2,3,4,5,5a,6,7,9a-octahydrospiro[
| OtherNames = anguidine
|Section1={{Chembox Identifiers
| ChemSpiderID = 82639
| SMILES = CC1=C[C@@H]2[C@](CC1)([C@]3([C@@H]([C@H]([C@H]([C@]34CO4)O2)O)OC(=O)C)C)COC(=O)C
| StdInChI = 1S/C19H26O7/c1-10-5-6-18(8-23-11(2)20)13(7-10)26-16-14(22)15(25-12(3)21)17(18,4)19(16)9-24-19/h7,13-16,22H,5-6,8-9H2,1-4H3/t13-,14-,15-,16-,17-,18-,19-/m1/s1
| StdInChIKey = AUGQEEXBDZWUJY-ZLJUKNTDSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo= 2270-40-8
| ChEMBL_Ref =
| ChEMBL =
| PubChem = 91518
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = UYL28I099N
| ChEBI_Ref =
| ChEBI =
}}
|Section2={{Chembox Properties
| C=19 | H=26 | O=7
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
}}
}}
Diacetoxyscirpenol (DAS), also called anguidine, is a mycotoxin from the group of type A trichothecenes. It is a secondary metabolite product of fungi of the genus Fusarium and may cause toxicosis in farm animals.{{cite journal|vauthors=Hoerr FJ, Carlton WW, Yagen B |title=Mycotoxicosis caused by a single dose of T-2 toxin or diacetoxyscirpenol in broiler chickens|journal=Vet. Pathol.|year=1981|volume=18|issue=5|pages=652–664|doi=10.1177/030098588101800510|pmid=7281462|s2cid=22715425|doi-access=free}}
The US Health and Human Services agency considers it a select agent for research purposes.{{cite web|title=Select Agents and Toxins list|date=17 May 2024 |url=https://www.selectagents.gov/sat/list.htm}}