:Diacetylnalorphine

{{Chembox

| ImageFile = Diacetylnalorphine.svg

| ImageClass = skin-invert-image

| ImageSize = 250px

| ImageAlt =

| IUPACName = 17-(Prop-2-en-1-yl)-7,8-didehydro-4,5α-epoxymorphinan-3,6α-diyl diacetate

| SystematicName = (4R,4aR,7S,7aR,12bS)-3-(Prop-2-en-1-yl)-2,3,4,4a,7,7a-hexahydro-1H-4,12-methano[1]benzofuro[3,2-e]isoquinoline-7,9-diyl diacetate

| OtherNames = O3,O6-Diacetyl-N-allyl-normorphine

|Section1={{Chembox Identifiers

| CASNo = 2748-74-5

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = Q083G8ZAJH

| PubChem = 20055473

| ChEMBL = 2106214

| ChemSpiderID = 16736941

| SMILES = CC(=O)O[C@H]1C=C[C@H]2[C@H]3CC4=C5[C@]2([C@H]1OC5=C(C=C4)OC(=O)C)CCN3CC=C}}

|Section2={{Chembox Properties

| Formula = C23H25NO5

| MolarMass = 395.4 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Diacetylnalorphine (BAN), also known as O3,O6-diacetyl-N-allyl-normorphine, is an opioid drug described as an analgesic and antidote which was never marketed.{{cite book| vauthors = Ganellin CR, Triggle DJ |title=Dictionary of Pharmacological Agents|url=https://books.google.com/books?id=A0THacd46ZsC&pg=PA1395|date=21 November 1996|publisher=CRC Press|isbn=978-0-412-46630-4|pages=1395–}} It is the 3,6-diacetyl ester of nalorphine, and therefore the heroin analogue of nalorphine. Diacetylnalorphine may behave as a prodrug to nalorphine, similarly to the cases of heroin (diacetylmorphine) to morphine and diacetyldihydromorphine to dihydromorphine.

See also

References