:Diacetylnalorphine
{{Chembox
| ImageFile = Diacetylnalorphine.svg
| ImageClass = skin-invert-image
| ImageSize = 250px
| ImageAlt =
| IUPACName = 17-(Prop-2-en-1-yl)-7,8-didehydro-4,5α-epoxymorphinan-3,6α-diyl diacetate
| SystematicName = (4R,4aR,7S,7aR,12bS)-3-(Prop-2-en-1-yl)-2,3,4,4a,7,7a-hexahydro-1H-4,12-methano[1]benzofuro[3,2-e]isoquinoline-7,9-diyl diacetate
| OtherNames = O3,O6-Diacetyl-N-allyl-normorphine
|Section1={{Chembox Identifiers
| CASNo = 2748-74-5
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = Q083G8ZAJH
| PubChem = 20055473
| ChEMBL = 2106214
| ChemSpiderID = 16736941
| SMILES = CC(=O)O[C@H]1C=C[C@H]2[C@H]3CC4=C5[C@]2([C@H]1OC5=C(C=C4)OC(=O)C)CCN3CC=C}}
|Section2={{Chembox Properties
| Formula = C23H25NO5
| MolarMass = 395.4 g/mol
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}
Diacetylnalorphine (BAN), also known as O3,O6-diacetyl-N-allyl-normorphine, is an opioid drug described as an analgesic and antidote which was never marketed.{{cite book| vauthors = Ganellin CR, Triggle DJ |title=Dictionary of Pharmacological Agents|url=https://books.google.com/books?id=A0THacd46ZsC&pg=PA1395|date=21 November 1996|publisher=CRC Press|isbn=978-0-412-46630-4|pages=1395–}} It is the 3,6-diacetyl ester of nalorphine, and therefore the heroin analogue of nalorphine. Diacetylnalorphine may behave as a prodrug to nalorphine, similarly to the cases of heroin (diacetylmorphine) to morphine and diacetyldihydromorphine to dihydromorphine.
See also
References
{{Reflist}}
{{Opioid receptor modulators}}
Category:Delta-opioid receptor antagonists
Category:Kappa-opioid receptor agonists
Category:Mu-opioid receptor antagonists
Category:Semisynthetic opioids
{{Analgesic-stub}}