:Diapocynin
{{chembox
| ImageFile = Diapocynin.svg
| PIN= 1,1′-(6,6′-Dihydroxy-5,5′-dimethoxy[1,1′-biphenyl]-3,3′-diyl)di(ethan-1-one)
| OtherNames= Diapocynin, 4′,4′′′-Dihydroxy-5′,5′′′-dimethoxy-3′,3′′′-biacetophenone
|Section1={{Chembox Identifiers
| CASNo= 29799-22-2
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = A65KM2ZD49
| PubChem = 9927489
| ChEMBL = 38775
| ChemSpiderID = 8103122
| SMILES = CC(=O)C1=CC(=C(C(=C1)OC)O)C2=C(C(=CC(=C2)C(=O)C)OC)O
| InChI = 1/C18H18O6/c1-9(19)11-5-13(17(21)15(7-11)23-3)14-6-12(10(2)20)8-16(24-4)18(14)22/h5-8,21-22H,1-4H3
| InChIKey = HLNDPICGHQGWSU-UHFFFAOYAP
| StdInChI = 1S/C18H18O6/c1-9(19)11-5-13(17(21)15(7-11)23-3)14-6-12(10(2)20)8-16(24-4)18(14)22/h5-8,21-22H,1-4H3
| StdInChIKey = HLNDPICGHQGWSU-UHFFFAOYSA-N
}}
|Section2={{Chembox Properties
| C=18 | H=18 | O=6
| Appearance= brown color
| Density=
| MeltingPtC=
| BoilingPt=
| Solubility=
}}
|Section7 ={{Chembox Hazards
| GHSPictograms = {{GHS09}}
| GHSSignalWord = Warning
| HPhrases = {{H-phrases|410}}
| PPhrases = {{P-phrases|273|391|501}}
}}
}}
Diapocynin is a dimer of apocynin.
Synthesis
Diapocynin is synthesized by the activation of apocynin with ferrous sulfate and sodium persulfate.{{cite journal | year = 2008 | title = Synthesis of diapocynin | journal = Journal of Chemical Education | volume = 85 | issue = 3| page = 411 | doi=10.1021/ed085p411 | last1 = Luchtefeld | first1 = Ron| bibcode = 2008JChEd..85..411L }} Similar to apocynin, it is shown to have some beneficial effects against oxidative stress and reducing reactive oxygen species.{{cite journal | last1 = Dranka | first1 = B. P. | last2 = Gifford | first2 = A. | last3 = Ghosh | first3 = A. | last4 = Zielonka | first4 = J. | last5 = Joseph | first5 = J. | last6 = Kanthasamy | first6 = A. G. | last7 = Kalyanaraman | first7 = B. | year = 2013 | title = Diapocynin prevents early Parkinson's disease symptoms in the leucine-rich repeat kinase 2 (LRRK2 R1441G) transgenic mouse | journal = Neuroscience Letters | volume = 549 | pages = 57–62 | doi=10.1016/j.neulet.2013.05.034| pmc = 3729885 | pmid=23721786}}{{cite journal|last1=Ismail|first1=Hesham M.|last2=Scapozza|first2=Leonardo|last3=Ruegg|first3=Urs T.|last4=Dorchies|first4=Olivier M.|title=Diapocynin, a Dimer of the NADPH Oxidase Inhibitor Apocynin, Reduces ROS Production and Prevents Force Loss in Eccentrically Contracting Dystrophic Muscle|journal=PLOS ONE|date=17 October 2014|volume=9|issue=10|pages=e110708|doi=10.1371/journal.pone.0110708|pmid=25329652|pmc=4201587|bibcode=2014PLoSO...9k0708I|doi-access=free}}
