:Dibenzocycloheptene

{{Chembox

| ImageFile = Dibenzocycloheptene.svg

| ImageAlt = Skeletal formula of dibenzocycloheptene

| ImageFile1 = Dibenzocycloheptene-3D-balls.png

| ImageSize1 = 220

| ImageAlt1 = Ball-and-stick model of the dibenzocycloheptene molecule

| PIN = 10,11-Dihydro-5H-dibenzo[a,d][7]annulene

| OtherNames = 10,11-dihydro-5H-dibenzo[a,d]cycloheptene

|Section1={{Chembox Identifiers

| CASNo = 833-48-7

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = GU7KLN5ED5

| PubChem = 70029

| ChemSpiderID = 63219

| SMILES = c1cc3c(cc1)Cc2c(cccc2)CC3

| InChI = InChI=1S/C15H14/c1-3-7-14-11-15-8-4-2-6-13(15)10-9-12(14)5-1/h1-8H,9-11H2

}}

|Section2={{Chembox Properties

| Formula = C₁₅H₁₄

| MolarMass = 194.27 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Dibenzocycloheptene (also known as dibenzosuberane and dibenzocycloheptadiene) is a tricyclic chemical compound featuring two benzene rings bound to a cycloheptene group. It is an occasional motif in synthetic organic chemistry.{{cite journal|doi=10.1021/ja993297d|title=C₂-Symmetric Dibenzosuberane-Based Helicenes as Potential Chirochromic Optical Switches|year=2000|last1=Chen|first1=Chien-Tien|last2=Chou|first2=Y-Chen|journal=Journal of the American Chemical Society|volume=122|issue=32|pages=7662–7672}} Various tricyclic antidepressants (TCAs) contain the dibenzocycloheptene moiety in their chemical structures, including amineptine, amitriptyline, amitriptylinoxide, butriptyline, demexiptiline, nortriptyline, noxiptiline, and protriptyline. Cyclobenzaprine, a skeletal muscle relaxant, also contains this functional group.