:Dibutylboron trifluoromethanesulfonate
{{Chembox
| ImageFile = dibutylboron triflate.svg
| ImageSize = 200px
| ImageAlt = Skeletal formula of DBBT
| ImageFile1 = Dibutylboron triflate 3D spacefill.png
| ImageAlt1 = Space-filling model of the DBBT molecule
| PIN = Dibutylborinic trifluoromethanesulfonic anhydride
| OtherNames = Dibutylboron triflate
|Section1={{Chembox Identifiers
| Abbreviations = DBBT
| CASNo = 60669-69-4
| PubChem = 2724243
| ChemSpiderID = 23621624
| SMILES = [B+](CCCC)CCCC.C(F)(F)(F)S(=O)(=O)[O-]
| InChI = 1S/C8H18B.CHF3O3S/c1-3-5-7-9-8-6-4-2;2-1(3,4)8(5,6)7/h3-8H2,1-2H3;(H,5,6,7)/q+1;/p-1
}}
|Section2={{Chembox Properties
| C=9 | H=18 | B=1 | F=3 | O=3 | S=1
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| GHSPictograms = {{GHS05}}
| GHSSignalWord = Danger
| HPhrases = {{H-phrases|314}}
| PPhrases = {{P-phrases|260|264|280|301+330+331|303+361+353|304+340|305+351+338|310|321|363|405|501}}
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Dibutylboron trifluoromethanesulfonate (also called dibutylboron triflate or DBBT) is a reagent in organic chemistry. Its chemical formula is C9H18BF3O3S. It is used in asymmetric synthesis for example in the formation of boron enolates in the aldol reaction.Organic Syntheses, Coll. Vol. 8, p.339 (1993); Vol. 68, p.83 (1990) [http://www.orgsyn.org/orgsyn/orgsyn/prepContent.asp?prep=CV8P0339 Link]