:Dinitolmide

{{chembox

| Verifiedfields = changed

| verifiedrevid = 470638079

| ImageFile=Zoalene.png

| ImageSize=150px

| PIN = 2-Methyl-3,5-dinitrobenzamide

| OtherNames = 3,5-Dinitro-o-toluamide
Zoalene

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 2982

| InChI = 1/C8H7N3O5/c1-4-6(8(9)12)2-5(10(13)14)3-7(4)11(15)16/h2-3H,1H3,(H2,9,12)

| InChIKey = ZEFNOZRLAWVAQF-UHFFFAOYAL

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 472565

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C8H7N3O5/c1-4-6(8(9)12)2-5(10(13)14)3-7(4)11(15)16/h2-3H,1H3,(H2,9,12)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = ZEFNOZRLAWVAQF-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo=148-01-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = AOX68RY4TV

| PubChem=3092

| SMILES = O=[N+]([O-])c1cc(cc(C(=O)N)c1C)[N+]([O-])=O

}}

|Section2={{Chembox Properties

| Formula=C₈H₇N₃O₅

| MolarMass=225.16 g/mol

| Appearance=

| Density=

| MeltingPtF=351

| MeltingPt_ref =

| BoilingPt=

| Solubility=

}}

|Section6={{Chembox Pharmacology

| ATCvet = yes

| ATCCode_prefix = P51

| ATCCode_suffix = AX12

}}

|Section7={{Chembox Hazards

| MainHazards=

| FlashPt=noncombustible

| FlashPt_ref =

| AutoignitionPt =

| PEL = none{{PGCH|0230}}

| REL = TWA 5 mg/m³

| IDLH = N.D.

}}

}}

Dinitolmide (or zoalene) is a fodder additive for poultry, used to prevent coccidiosis infections.{{Cite journal

| doi = 10.1637/9572-101310-Reg.1

| last1 = Gerhold | first1 = R. W.

| last2 = Fuller | first2 = A. L.

| last3 = Lollis | first3 = L.

| last4 = Parr | first4 = C.

| last5 = McDougald | first5 = L. R.

| title = The Efficacy of Anticoccidial Products against Eimeria spp. in Northern Bobwhites

| journal = Avian Diseases

| volume = 55

| issue = 1

| pages = 59–64

| year = 2011

| pmid = 21500637

| s2cid = 30943649 }} It is sold under trade names such as Coccidine A, Coccidot, and Zoamix.

Dinitolmide is usually added to feed in doses of 125 ppm (preventive) or 250 ppm (curative). It is a broad-spectrum anticoccidial drug, preventing seven main strains of Eimeria coccidium. It leaves no residues in tissues.{{fact|date=December 2013}} It can be also used to prevent coccidiosis of domestic rabbits.