:Diosgenin

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 443694007

| ImageFile = Diosgenin.svg

| ImageSize = 230px

| ImageFile2 = Diosgenina3D.png

| ImageSize2 = 200px

| IUPACName = (25R)-Spirost-5-en-3β-ol

| SystematicName = (2S,2′R,4aR,4bS,5′R,6aS,6bR,7S,9aS,10aS,10bS)-4′,4a,6a,7-Tetramethyl-1,2,3,4,4a,4b,5,6,6a,6b,7,9a,10,10a,10b,11-hexadecahydrospiro[naphtho[2′,1′:4,5]indeno[2,1-b]furan-8,2′-oxan]-2-ol

| OtherNames =

| Section1 = {{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 512-04-9

| PubChem = 99474

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 4629

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 412437

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = K49P2K8WLX

| SMILES = O1[C@@H]4[C@H]([C@@H]([C@]12OC[C@@H](CC2)C)C)[C@@]5(C)CC[C@@H]3[C@@]6(C(=C/C[C@H]3[C@@H]5C4)\C[C@@H](O)CC6)C

| EINECS = 208-134-3

| InChI=1/C27H42O3/c1-16-7-12-27(29-15-16)17(2)24-23(30-27)14-22-20-6-5-18-13-19(28)8-10-25(18,3)21(20)9-11-26(22,24)4/h5,16-17,19-24,28H,6-15H2,1-4H3/t16-,17+,19+,20-,21+,22+,23+,24+,25+,26+,27-/m1/s1

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI=1S/C27H42O3/c1-16-7-12-27(29-15-16)17(2)24-23(30-27)14-22-20-6-5-18-13-19(28)8-10-25(18,3)21(20)9-11-26(22,24)4/h5,16-17,19-24,28H,6-15H2,1-4H3/t16-,17+,19+,20-,21+,22+,23+,24+,25+,26+,27-/m1/s1

| InChIKey = WQLVFSAGQJTQCK-VKROHFNGBS

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = WQLVFSAGQJTQCK-VKROHFNGSA-N

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 89870

}}

| Section2 = {{Chembox Properties

| C=27 | H=42 | O=3

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Diosgenin, a phytosteroid sapogenin, is the product of hydrolysis by acids, strong bases, or enzymes of saponins, extracted from the tubers of Dioscorea wild yam species, such as the Kokoro. It is also present in smaller amounts in a number of other species. The sugar-free (aglycone) product of such hydrolysis, diosgenin is used for the commercial synthesis of cortisone, pregnenolone, progesterone, and other steroid products.