:Diphenyldichloromethane

{{Chembox

| Watchedfields = changed

| verifiedrevid = 431344616

| ImageFile = Diphenyldichloromethane.svg

| ImageSize =

| ImageAlt =

| PIN = 1,1′-(Dichloromethylene)dibenzene

| OtherNames = Dichlorodiphenylmethane

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 2051-90-3

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 81FEZ29AK6

| Beilstein = 1910601

| PubChem = 16327

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 15492

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI =1S/C13H10Cl2/c14-13(15,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = OPTDDWCXQQYKGU-UHFFFAOYSA-N

| SMILES = c1ccc(cc1)C(c2ccccc2)(Cl)Cl}}

|Section2={{Chembox Properties

| C=13 | H=10 | Cl=2

| Appearance = slightly yellow liquid

| Density = 1.235 g/cm³

| MeltingPtC = 146 to 150

| MeltingPt_ref = {{cite journal|last=Ballester|first=Manuel|author2=Juan Riera-Figueras |author3=Juan Castaner |author4=Carlos Badfa |author5=Jose M. Monso |year=1971|title=Inert carbon free radicals. I. Perchlorodiphenylmethyl and perchlorotriphenylmethyl radical series|journal=Journal of the American Chemical Society|volume=93|issue=9|pages=2215–2225|issn=0002-7863|doi=10.1021/ja00738a021}}

| BoilingPtC = 193

| BoilingPt_notes = at 32 torr{{cite journal|last=Andrews|first=L. J.|author2=W. W. Kaeding|year=1951|journal=Journal of the American Chemical Society|volume=73 |issue=3|pages=1007–1011|issn=0002-7863 |doi=10.1021/ja01147a036 | title = The Formation of Benzophenone and its Diethylketal in the Ethanolysis of Diphenyldichloromethane}}

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPtC = 110

| AutoignitionPtC =

}}

}}

Diphenyldichloromethane is an organic compound with the formula (C₆H₅)₂CCl₂. It is a colorless solid that is used as a precursor to other organic compounds.