:Disodium malonate

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 333544557

| Name = Disodium malonate

| ImageFile = disodium malonate.png

| ImageSize = 180px

| ImageName =

| PIN = Disodium propanedioate

| OtherNames = Sodium malonate

| Section1 = {{Chembox Identifiers

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 359504

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 141-95-7

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 9QWE64M39H

| PubChem = 8865

| EINECS = 205-14-0

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 8532

| SMILES = [Na+].[Na+].[O-]C(=O)CC([O-])=O

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C3H4O4.2Na/c4-2(5)1-3(6)7;;/h1H2,(H,4,5)(H,6,7);;/q;2*+1/p-2

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = PRWXGRGLHYDWPS-UHFFFAOYSA-L

}}

| Section2 = {{Chembox Properties

| Formula = C₃H₂O₄Na₂

| MolarMass = 148.025 g/mol

| Density =

| Solubility =

| MeltingPt =

| BoilingPt = 659.93K

}}

Disodium malonate is a sodium salt of malonic acid with the chemical formula CH₂(COONa)₂. It is a white crystal soluble in water but not in alcohols, esters or benzene. It can be prepared from the reaction of sodium hydroxide and malonic acid:

:CH₂(COOH)₂ + 2 NaOH → CH₂(COONa)₂ + 2 H₂O