:Disperse Yellow 26
{{Chembox
| ImageFile = Disperse Yellow 26.svg
| ImageSize = 200px
| ImageAlt =
| PIN = 4-Chloro-2-nitro-N-phenylaniline
| OtherNames = 4-Chloro-2-nitrodiphenylamine
N-(4-Chloro-2-nitrophenyl)aniline
C.I. 10348 (Colour index numbers)
| Section1 = {{Chembox Identifiers
| CASNo = 16611-15-7
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = H52PM8WW87
| PubChem = 85511
| ChemSpiderID = 77121
| SMILES = c1ccc(cc1)Nc2ccc(cc2[N+](=O)[O-])Cl
| StdInChI=1S/C12H9ClN2O2/c13-9-6-7-11(12(8-9)15(16)17)14-10-4-2-1-3-5-10/h1-8,14H
| StdInChIKey = GYOVQZDXSHTPBS-UHFFFAOYSA-N
}}
| Section2 = {{Chembox Properties
| C=12|H=9|Cl=1|N=2|O=2
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Disperse Yellow 26, or 4-chloro-2-nitrodiphenylamine, is a disperse dye. The dye is used in polyamide and vinegar fiber dyeing. Disperse Yellow 26 is produced by the condensation of aniline and 1,4-dichloro-2-nitrobenzene.
