:ELQ-300

{{Chembox

| ImageFile = ELQ-300.svg

| ImageSize =

| ImageAlt =

| PIN = 6-Chloro-7-methoxy-2-methyl-3-{4-[4-(trifluoromethoxy)phenoxy]phenyl}quinolin-4(1H)-one

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 1354745-52-0

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = BRC5YE92RX

| PubChem = 67016608

| ChemSpiderID = 28540481

| ChEMBL = 2431810

| SMILES = Cc1c(c(=O)c2cc(c(cc2[nH]1)OC)Cl)c3ccc(cc3)Oc4ccc(cc4)OC(F)(F)F

| InChI = 1/C24H17ClF3NO4/c1-13-22(23(30)18-11-19(25)21(31-2)12-20(18)29-13)14-3-5-15(6-4-14)32-16-7-9-17(10-8-16)33-24(26,27)28/h3-12H,1-2H3,(H,29,30)

| InChIKey = WZDNKHCQIZRDKW-UHFFFAOYAI

| StdInChI = 1S/C24H17ClF3NO4/c1-13-22(23(30)18-11-19(25)21(31-2)12-20(18)29-13)14-3-5-15(6-4-14)32-16-7-9-17(10-8-16)33-24(26,27)28/h3-12H,1-2H3,(H,29,30)

| StdInChIKey = WZDNKHCQIZRDKW-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=24 | H=17 | Cl=1 | F=3 | N=1 | O=4

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

ELQ-300 is an experimental antimalarial medication. It is the first entry in a new class of antimalarials known as 4-quinolone-3-diarylethers.{{cite journal|author=Nilsen A|title=Quinolone-3-diarylethers: a new class of antimalarial drug|journal=Science Translational Medicine|volume=5|issue=177|year=2013|pages=177ra37|issn=1946-6234|doi=10.1126/scitranslmed.3005029|display-authors=etal|pmid=23515079|pmc=4227885}}

ELQ-300 acts as an inhibitor of the mitochondrial cytochrome bc₁ complex (complex III in the electron transport chain) - A mechanism shared with some of the most potent fungicides known, the strobilurins. In preclinical studies with mice, ELQ-300 was found to be highly active against Plasmodium falciparum and Plasmodium vivax at all life cycle stages that play a role in the transmission of malaria, and to have good oral bioavailability.