:ERDRP-0519

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 2-methyl-N-[4-[(2S)-2-(2-morpholin-4-ylethyl)piperidin-1-yl]sulfonylphenyl]-5-(trifluoromethyl)pyrazole-3-carboxamide

| image = ERDRP-0519.svg

| tradename =

| legal_US = Investigational New Drug

| legal_status =

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 1374006-96-8

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = V5S4Z5Q9VU

| PubChem = 57521469

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| ChemSpiderID = 28514843

| C=23 | H=30 | F=3 | N=5 | O=4 | S=1

| smiles = Cn1c(cc(n1)C(F)(F)F)C(=O)Nc2ccc(cc2)S(=O)(=O)N3CCCC[C@H]3CCN4CCOCC4

| StdInChI = 1S/C23H30F3N5O4S/c1-29-20(16-21(28-29)23(24,25)26)22(32)27-17-5-7-19(8-6-17)36(33,34)31-10-3-2-4-18(31)9-11-30-12-14-35-15-13-30/h5-8,16,18H,2-4,9-15H2,1H3,(H,27,32)/t18-/m0/s1

| StdInChIKey = JVZHTUQIMBYDSX-SFHVURJKSA-N

}}

ERDRP-0519 is an antiviral drug which is the first drug specifically developed to target the measles morbillivirus. It acts as an inhibitor of the viral enzyme RNA polymerase which is essential for viral replication, and in animal studies showed good oral bioavailability and protected ferrets from otherwise lethal doses of a morbillivirus when administered up to three days after infection.{{cite journal | vauthors = White LK, Yoon JJ, Lee JK, Sun A, Du Y, Fu H, Snyder JP, Plemper RK | display-authors = 6 | title = Nonnucleoside inhibitor of measles virus RNA-dependent RNA polymerase complex activity | journal = Antimicrobial Agents and Chemotherapy | volume = 51 | issue = 7 | pages = 2293–2303 | date = July 2007 | pmid = 17470652 | pmc = 1913224 | doi = 10.1128/AAC.00289-07 }}{{cite journal | vauthors = Krumm SA, Yan D, Hovingh ES, Evers TJ, Enkirch T, Reddy GP, Sun A, Saindane MT, Arrendale RF, Painter G, Liotta DC, Natchus MG, von Messling V, Plemper RK | display-authors = 6 | title = An Orally Available, Small-Molecule Polymerase Inhibitor Shows Efficacy Against a Lethal Morbillivirus Infection in a Large Animal Model | journal = Science Translational Medicine | volume = 6 | issue = 232 | pages = 232ra52 | date = April 2014 | pmid = 24739760 | pmc = 4080709 | doi = 10.1126/scitranslmed.3008517 }}

History

The research was done at Georgia State University and the Paul Ehrlich Institute.{{Cite web| vauthors = Grush L |date=2015-03-24|title=New oral drug can stop measles infection before symptoms begin|url=https://www.foxnews.com/health/new-oral-drug-can-stop-measles-infection-before-symptoms-begin|access-date=2020-11-18|website=Fox News|language=en-US}}

See also

References