:Elassovalene

{{Chembox

| ImageFile = Elassovalene.svg

| ImageSize = 120px

| PIN = 2a,2a1-Dihydrocyclopenta[cd]azulene

| OtherNames =

| Section1 = {{Chembox Identifiers

| CASNo = 38310-40-6

| ChemSpiderID = 125478

| PubChem = 142246

| UNII = 5HK24EQ36P

| SMILES = C1=CC=C2C=CC3C2C(=C1)C=C3

| StdInChI= 1S/C12H10/c1-2-4-10-6-8-11-7-5-9(3-1)12(10)11/h1-8,11-12H

| StdInChIKey = HXHFTTRCEKEWIZ-UHFFFAOYSA-N

}}

| Section2 = {{Chembox Properties

| C=12|H=10

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Elassovalene (2a,8b-dihydro-cyclopent[cd]azulene) is a polycyclic hydrocarbon with chemical formula C12H10, composed of one cycloheptatriene ring and two fused cyclopentene rings.{{Cite book|title=Organic Chemistry: The Name Game: Modern Coined Terms and Their Origins|last1=Nickon|first1=Alex|last2=Silversmith|first2=Ernest F.|publisher=Elsevier|year=2013|isbn=978-1483145235|location=|pages=297|quote=}}

See also

References