:Eletefine

{{chembox

| verifiedrevid = 424908834

| Name = Eletefine

| ImageFile = Eletefine.svg

| OtherNames =

| Section1 = {{Chembox Identifiers

| SMILES = O(c4c2c3c(C=1O\C(=C/CC(O)CC=1)c3ncc2)c(OC)c4OC)C

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 8840283

| PubChem = 10664930

| InChI = 1/C19H19NO5/c1-22-17-11-8-9-20-16-13-7-5-10(21)4-6-12(25-13)15(14(11)16)18(23-2)19(17)24-3/h6-10,21H,4-5H2,1-3H3/b12-6-,13-7-

| InChIKey = LRIBDPPXLMPCHW-QXFGSWAMBK

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C19H19NO5/c1-22-17-11-8-9-20-16-13-7-5-10(21)4-6-12(25-13)15(14(11)16)18(23-2)19(17)24-3/h6-10,21H,4-5H2,1-3H3/b12-6-,13-7-

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = LRIBDPPXLMPCHW-QXFGSWAMSA-N

| CASNo =

| RTECS =

}}

| Section2 = {{Chembox Properties

| Formula = C₁₉H₁₉NO₅

| MolarMass = 343.357 g/mol

| Appearance = red waxy solid

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Structure

| MolShape =

| Dipole =

}}

| Section7 = {{Chembox Hazards

| FlashPt =

}}

| Section8 = {{Chembox Related

| Function =

| OtherFunctn =

| OtherCpds =

}}

}}

Eletefine is an isoquinoline alkaloid first isolated in 1998 from Cissampelos glaberrima.{{cite journal | doi = 10.1021/np980018b |date=Sep 1998 |vauthors=da Cunha EV, Cornelio ML, Barbosa Filho JM, Braz FR, Gray AI | title = Eletefine, a stephaoxocane alkaloid from Cissampelos glaberrima | volume = 61 | issue = 9 | pages = 1140–2 | issn = 0163-3864 | pmid = 9748384 | journal = Journal of Natural Products}} It is one of few known compounds containing the so-called stephaoxocane skeleton, alongside stephaoxocanidine, excentricine, and the stephalonganines.{{Cite journal| first1 = N.| first2 = S.| first3 = M.| first4 = M.| first5 = J.| last1 = Kashiwaba| first6 = H.| first7 = T. | title = Stephaoxocanidine, a New Isoquinoline Alkaloid from Stephania cepharantha | journal = Natural Product Research | volume = 9| issue = 3 | pages = 177–714 | year = 1997 | doi = 10.1080/10575639708048312| last2 = Morooka| last3 = Kimura| last4 = Ono| last5 = Toda| last6 = Suzuki| last7 = Sano}}{{Cite journal| first1 = A. B. J.| first2 = T. S. | title = An alternative and convenient synthesis of oct-7-enal, a naturally-occurring aldehyde isolated from the Japanese thistle Cirsium dipsacolepis| last1 = Bracca| journal = Journal of the Brazilian Chemical Society | volume = 19| issue = 6| pages = 1125–1128| year = 2008 | doi = 10.1590/S0103-50532008000600011| last2 = Kaufman| doi-access = free}}{{Cite journal| last1 = Zhang | first1 = H.| last2 = Yue | first2 = J. -M. | title = New Stephaoxocane Alkaloids from Stephania longa | journal = Helvetica Chimica Acta | volume = 89| issue = 6 | pages = 1105| year = 2006 | doi = 10.1002/hlca.200690108 }}