:Eprozinol

{{chembox

| Verifiedfields = changed

| verifiedrevid = 444415351

| ImageFile=Eprozinol.svg

| ImageSize=

| PIN=3-[4-(2-Methoxy-2-phenylethyl)piperazin-1-yl]-1-phenylpropan-1-ol

| OtherNames=

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=32665-36-4

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2107691

| PubChem=122553

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07379

| SMILES=COC(CN1CCN(CC1)CCC(C2=CC=CC=C2)O)C3=CC=CC=C3

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 109268

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C22H30N2O2/c1-26-22(20-10-6-3-7-11-20)18-24-16-14-23(15-17-24)13-12-21(25)19-8-4-2-5-9-19/h2-11,21-22,25H,12-18H2,1H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = QSRHLIUOSXVKTG-UHFFFAOYSA-N

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = IJ21AK8IVJ

}}

|Section2={{Chembox Properties

| Formula=C₂₂H₃₀N₂O₂

| MolarMass=354.4858

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section6={{Chembox Pharmacology

| ATCCode_prefix = R03

| ATCCode_suffix = DX02

}}

|Section7={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt=

}}

}}

Eprozinol is a drug for obstructive airway disease.{{Cite journal

| last1 = Nicrosini | first1 = F.

| last2 = Carpinella | first2 = G.

| title = Eprozinol treatment of chronic bronchitis with dyspnea and cough

| journal = Broncho-pneumologie

| volume = 28

| issue = 4

| pages = 322–327

| year = 1978

| pmid = 756799

}}{{Cite journal

| last1 = Labrid | first1 = C.

| last2 = Duchene-Marullaz | first2 = P.

| last3 = Rispat | first3 = G.

| title = Mechanisms of anti-bronchoconstrictive effects of eprozinol. II. In vivo studies on the guinea pig

| journal = Pharmacology

| volume = 23

| issue = 1

| pages = 48–55

| year = 1981

| pmid = 7312935

| doi=10.1159/000137526

}}