:Ethyl oleate
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477198559
| ImageFile = Ethyl oleate.png
| ImageSize = 250px
| PIN = Ethyl (9Z)-octadec-9-enoate
| OtherNames = Oleic acid ethyl ester
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4515636
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = Z2Z439864Y
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D04090
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 84940
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 2106289
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C20H38O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-4-2/h11-12H,3-10,13-19H2,1-2H3/b12-11-
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = LVGKNOAMLMIIKO-QXMHVHEDSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 111-62-6
| PubChem = 5363269
| SMILES = O=C(OCC)CCCCCCC\C=C/CCCCCCCC
}}
|Section2={{Chembox Properties
| C=20 | H=38 | O=2
| Appearance = Colorless to light yellow liquid{{GESTIS|ZVG=101777}}
| MeltingPtC = -32
| BoilingPtC = 216-218
| BoilingPt_notes = (15 hPa)
}}
|Section3={{Chembox Hazards
| MainHazards =
| AutoignitionPt =
}}
}}
Ethyl oleate is a fatty acid ester formed by the condensation of oleic acid and ethanol. It is a colorless oil although degraded samples can appear yellow.
Use and occurrence
=Additive=
Ethyl oleate is used by compounding pharmacies as a vehicle for intramuscular drug delivery, in some cases to prepare the daily doses of progesterone in support of pregnancy. Studies that document the safe use of ethyl oleate in pregnancy for both the mother and the fetus have never been performed. It is regulated as a food additive in the U.S. by the Food and Drug Administration."Food Additives Permitted for Direct Addition to Food for Human Consumption", 21CFR172.515 Ethyl oleate is used as a solvent for pharmaceutical drug preparations involving lipophilic substances such as steroids.{{cite journal |vauthors=Ory SJ, Hammond CB, Yancy SG, Hendren RW, Pitt CG |title=The effect of a biodegradable contraceptive capsule (Capronor) containing levonorgestrel on gonadotropin, estrogen, and progesterone levels |journal=Am. J. Obstet. Gynecol. |volume=145 |issue=5 |pages=600–5 |year=1983 |pmid=6402933 |doi=10.1016/0002-9378(83)91204-8}}
=Chemistry=
It also finds use as a lubricant and a plasticizer. Louis Bouveault used ethyl oleate to demonstrate Bouveault–Blanc reduction, producing oleyl alcohol and ethanol,{{cite journal |last1 = Bouveault |first1 = Louis |authorlink1 = Louis Bouveault |last2 = Blanc |first2 = Gustave Louis | journal = Bull. Soc. Chim. Fr. | year = 1904 | volume = 31 | issue = 3 | pages = 1210–1213 | title = Hydrogénation des éthers des acides possédant en outre les fonctions éther-oxyde ou acétal | language = French | trans-title = Hydrogenation of the ether of the acids furthermore possessing the ether-oxide or acetal functions | url = http://gallica.bnf.fr/ark:/12148/bpt6k5469971k/f1214.image}} a method which was subsequently refined and published in Organic Syntheses.{{OrgSynth|last1 = Adkins|first1 = Homer|authorlink1 = Homer Burton Adkins|last2 = Gillespie|first2 = R. H.|title = Oleyl alcohol|collvol = 3|collvolpages = 671|year = 1949|volume = 29|pages = 80|doi = 10.15227/orgsyn.029.0080|prep = cv3p0671}}
=Occurrence=
Ethyl oleate has been identified as a primer pheromone in honeybees.{{cite journal |author=Leoncini I. |title=Regulation of behavioral maturation by a primer pheromone produced by adult worker honey bees|journal=Proc. Natl. Acad. Sci. U.S.A. |volume=101 |issue=50 |pages=17559–17564 |year=2004|doi=10.1073/pnas.0407652101 |pmid=15572455 |last2=Le Conte |first2=Y |last3=Costagliola |first3=G |last4=Plettner |first4=E |last5=Toth |first5=AL |last6=Wang |first6=M |last7=Huang |first7=Z |last8=Bécard |first8=JM |last9=Crauser |first9=D |last10=Slessor|first10=K. N.|last11=Robinson|first11=G. E.|pmc=536028|display-authors=8|doi-access=free}}
=Precursor to other chemicals=
By the process of ethenolysis, the methyl ester of oleic acid, converts to 1-decene and methyl 9-decenoate:{{ cite journal | last1 = Marinescu | first1 = Smaranda C. | last2 = Schrock | first2 = Richard R. | last3 = Müller | first3 = Peter | last4 = Hoveyda | first4 = Amir H. | title = Ethenolysis Reactions Catalyzed by Imido Alkylidene Monoaryloxide Monopyrrolide (MAP) Complexes of Molybdenum | journal = J. Am. Chem. Soc. | year = 2009 | volume = 131 | issue = 31 | pages = 10840–10841 | doi = 10.1021/ja904786y | pmid=19618951}}
:{{chem2|CH3(CH2)7CH\dCH(CH2)7CO2Me +}} CH2=CH2 → CH3(CH2)7CH=CH2 + MeO2C(CH2)7CH=CH2
=Medical aspects=
Ethyl oleate is produced by the body during ethanol intoxication.{{cite journal |vauthors=Dan L, Laposata M |title=Ethyl palmitate and ethyl oleate are the predominant fatty acid ethyl esters in the blood after ethanol ingestion and their synthesis is differentially influenced by the extracellular concentrations of their corresponding fatty acids |journal=Alcohol. Clin. Exp. Res. |volume=21 |issue=2 |pages=286–92 |year=1997 |pmid=9113265 |doi=10.1111/j.1530-0277.1997.tb03762.x}} It is one of the fatty acid ethyl esters (FAEE) produced after ingestion of ethanol. Some research literature implicates FAEEs such as ethyl oleate as the toxic mediators of ethanol in the body (pancreas, liver, heart, and brain).{{Cite journal | author = Laposata M.|title=Fatty acid ethyl esters: nonoxidative metabolites of ethanol|journal=Addiction Biology|year=1998|volume=3|issue=1|pages=5–14 |doi=10.1080/13556219872308|pmid=26736076|s2cid=22486675|doi-access=free}}{{cite journal | author = Laposata M | title = Fatty acid ethyl esters: recent observations | journal = Prostaglandins, Leukotrienes, and Essential Fatty Acids | year = 2002 | volume = 67 | issue = 2–3 | pages = 193–196 |name-list-style=vanc | display-authors = 1 | doi = 10.1054/plef.2002.0418 | last2 = Hasaba | first2 = Ali | last3 = Best | first3 = Catherine A. | last4 = Yoerger | first4 = Danita M. | last5 = McQuillan | first5 = Brendan M. | last6 = Salem | first6 = Raneem O. | last7 = Refaai | first7 = Majed A. | last8 = Soderberg | first8 = Britt L.| pmid = 12324241 }} Ethyl oleate may be the toxic mediator of alcohol in fetal alcohol syndrome. The oral ingestion of ethyl oleate has been carefully studied and due to rapid degradation in the digestive tract it appears safe for oral ingestion.{{cite journal | author = Saghir M. | title = Rapid in vivo hydrolysis of fatty acid ethyl esters, toxic nonoxidative ethanol metabolites | journal = Am J Physiol | year = 1997 | volume = 273 | issue = 1 Pt 1 | pages = G184–190| doi = 10.1152/ajpgi.1997.273.1.G184 | pmid = 9252525 }}