:Ethyl protocatechuate

{{chembox

| Watchedfields =

| verifiedrevid =

| Reference = [http://www.fao.org/ag/agn/jecfa-additives/specs/Monograph1/Additive-184.pdf Ethyl protocatechuate on FAO website]{{Dead link|date=March 2024 |bot=InternetArchiveBot |fix-attempted=yes }}

| ImageFile = Ethyl_protocatechuate.svg

| ImageSize = 200px

| PIN = Ethyl 3,4-dihydroxybenzoate

| OtherNames = Ethyl ester of 3,4-dihydroxybenzoic acid
3,4-Dihydroxybenzoic acid ethyl ester
EDHB
Ethyl-3,4-dihydroxybenzoate

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 3943-89-3

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 4YGJ96WTBG

| RTECS =

| PubChem = 77547

| ChemSpiderID = 69954

| ChEBI = 132364

| EINECS = 223-529-0

| InChI = 1S/C9H10O4/c1-2-13-9(12)6-3-4-7(10)8(11)5-6/h3-5,10-11H,2H2,1H3

| InChIKey = KBPUBCVJHFXPOC-UHFFFAOYSA-N

| SMILES = CCOC(=O)C1=CC(=C(C=C1)O)O

}}

|Section2={{Chembox Properties

| C=9|H=10|O=4

| Appearance = White or pale brownish yellow, crystalline powder; odorless or has a faint

phenol-like odour

| Density =

| MeltingPtC = 132 to 135

| MeltingPt_notes =

| BoilingPtC = 357 to 358

| BoilingPt_ref = [http://www.thegoodscentscompany.com/data/rw1244061.html Ethyl protocatechuate on www.thegoodscentscompany.com]

| Solubility = Insoluble in water; soluble in ethanol

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Ethyl protocatechuate is a phenolic compound. It can be found in the peanut seed testa.{{Cite journal | last1 = Huang | first1 = S. C. | last2 = Yen | first2 = G. C. | last3 = Chang | first3 = L. W. | last4 = Yen | first4 = W. J. | last5 = Duh | first5 = P. D. | title = Identification of an Antioxidant, Ethyl Protocatechuate, in Peanut Seed Testa | doi = 10.1021/jf0210019 | journal = Journal of Agricultural and Food Chemistry | volume = 51 | issue = 8 | pages = 2380–2383 | year = 2003 | pmid = 12670184}}{{Cite journal | last1 = Yen | first1 = W. J. | last2 = Chang | first2 = L. W. | last3 = Duh | first3 = P. D. | doi = 10.1016/j.lwt.2004.06.004 | title = Antioxidant activity of peanut seed testa and its antioxidative component, ethyl protocatechuate | journal = LWT - Food Science and Technology | volume = 38 | issue = 3 | pages = 193 | year = 2005 }} It is also present in wine.{{Cite journal | last1 = Baderschneider | first1 = B. | last2 = Winterhalter | first2 = P. | doi = 10.1021/jf010396d | title = Isolation and Characterization of Novel Benzoates, Cinnamates, Flavonoids, and Lignans from Riesling Wine and Screening for Antioxidant Activity | journal = Journal of Agricultural and Food Chemistry | volume = 49 | issue = 6 | pages = 2788–2798 | year = 2001 | pmid = 11409967}} It is the ethylic ester of protocatechuic acid.

The compound is a prolyl 4-hydroxylase inhibitor{{Cite journal | last1 = Wang | first1 = J. | last2 = Buss | first2 = J. L. | last3 = Chen | first3 = G. | last4 = Ponka | first4 = P. | last5 = Pantopoulos | first5 = K. | title = The prolyl 4-hydroxylase inhibitor ethyl-3,4-dihydroxybenzoate generates effective iron deficiency in cultured cells | doi = 10.1016/S0014-5793(02)03389-6 | journal = FEBS Letters | volume = 529 | issue = 2–3 | pages = 309–312 | year = 2002 | pmid = 12372619| s2cid = 32329352 | doi-access = free }} and can be used to protect the myocardium.{{Cite journal

| last1 = Philipp | first1 = S.

| last2 = Cui | first2 = L.

| last3 = Ludolph | first3 = B.

| last4 = Kelm | first4 = M.

| last5 = Schulz | first5 = R.

| last6 = Cohen | first6 = M. V.

| last7 = Downey | first7 = J. M.

| doi = 10.1152/ajpheart.00472.2005

| title = Desferoxamine and ethyl-3,4-dihydroxybenzoate protect myocardium by activating NOS and generating mitochondrial ROS

| journal = AJP: Heart and Circulatory Physiology

| volume = 290

| issue = 1

| pages = H450–H457

| year = 2005

| pmid = 16155105

}}

See also

References

{{Reflist}}

{{Phenolic acid}}

Category:Dihydroxybenzoic acids

Category:Hydrolase inhibitors

{{phenol-stub}}