:Eutylone

{{Short description|Designer drug of the cathinone class}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 451555065

| IUPAC_name = (±)-1-(1,3-benzodioxol-5-yl)-2-(ethylamino)butan-1-one

| image = Eutylone.svg

| tradename =

| pregnancy_category =

| legal_AU =

| legal_BR = F2

| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-07-24 |title=RDC Nº 804 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 804 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |url-status=live |archive-url=https://web.archive.org/web/20230827163149/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |archive-date=2023-08-27 |access-date=2023-08-27 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-07-25}}

| legal_CA = Schedule I

| legal_DE = Anlage II

| legal_UK = Class B

| legal_US = Schedule I

| legal_UN = P II

| legal_UN_comment = {{Cite web |title=Substance Details Eutylone |url=https://www.unodc.org/LSS/Substance/Details/29eff971-208a-4a67-98d6-71f53923862e |access-date=2024-01-22}}

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 802855-66-9

| index_label =

| index2_label = HCl

| CAS_number2_Ref = {{cascite|correct|CAS}}

| CAS_number2 = 17764-18-0

| UNII2_Ref = {{fdacite|correct|FDA}}

| UNII2 = 4FNX1J271X

| ATC_prefix = none

| ATC_suffix =

| PubChem = 57360686

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C22708

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = D6WQJ7NF96

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 26716427

| C=13 | H=17 | N=1 | O=3

| smiles = CCC(C(=O)C1=CC2=C(C=C1)OCO2)NCC

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C13H17NO3/c1-3-10(14-4-2)13(15)9-5-6-11-12(7-9)17-8-16-11/h5-7,10,14H,3-4,8H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = YERSNXHEOIYEGX-UHFFFAOYSA-N

}}

Eutylone (also known as β-keto-1,3-benzodioxolyl-N-ethylbutanamine, bk-EBDB, and N-ethylbutylone) is a stimulant and empathogenic drug of the phenethylamine, amphetamine, phenylisobutylamine, and cathinone families which was developed in the 1960s,{{Cite patent|country=GB|number=108513|pubdate=1967-09-27|title=Aryl-α-aminoketone derivatives|assign1=Boehringer Ingelheim}}{{cite journal | vauthors = Glatfelter GC, Walther D, Evans-Brown M, Baumann MH | title = Eutylone and Its Structural Isomers Interact with Monoamine Transporters and Induce Locomotor Stimulation | journal = ACS Chemical Neuroscience | volume = 12 | issue = 7 | pages = 1170–1177 | date = April 2021 | pmid = 33689284 | doi = 10.1021/acschemneuro.0c00797 | pmc = 9423000 | s2cid = 232192447 }} which is classified as a designer drug.{{cite web | url=http://nsddb.eu/substance/413/ | title=Eutylone | date=12 November 2023 | publisher=New Synthetic Drugs Database}} It was first reported to the EMCDDA in 2014 and became widespread internationally in 2019-2020 following bans on the related compound ephylone.{{cite journal | vauthors = Bade R, White JM, Nguyen L, Tscharke BJ, Mueller JF, O'Brien JW, Thomas KV, Gerber C | display-authors = 6 | title = Determining changes in new psychoactive substance use in Australia by wastewater analysis | journal = The Science of the Total Environment | volume = 731 | pages = 139209 | date = August 2020 | pmid = 32417485 | doi = 10.1016/j.scitotenv.2020.139209 | bibcode = 2020ScTEn.73139209B | s2cid = 218680033 | url = https://unisa.alma.exlibrisgroup.com/view/delivery/61USOUTHAUS_INST/12200648250001831 | url-access = subscription }}{{cite journal | vauthors = Krotulski AJ, Papsun DM, Chronister CW, Homan J, Crosby MM, Hoyer J, Goldberger BA, Logan BK | display-authors = 6 | title = Eutylone Intoxications-An Emerging Synthetic Stimulant in Forensic Investigations | journal = Journal of Analytical Toxicology | date = August 2020 | volume = 45 | issue = 1 | pages = 8–20 | pmid = 33325503 | doi = 10.1093/jat/bkaa113 | doi-access = free }}{{cite journal | vauthors = Chen HY, Chien WC, Huang MN, Fang CC, Weng TI | title = Analytically confirmed eutylone (bk-EBDB) exposure in emergency department patients | journal = Clinical Toxicology | pages = 846–848 | date = January 2021 | volume = 59 | issue = 9 | pmid = 33448882 | doi = 10.1080/15563650.2020.1868491 | s2cid = 231611658 }}{{cite journal | vauthors = Nakamura M, Takaso M, Takeda A, Hitosugi M | title = A fatal case of intoxication from a single use of eutylone: Clinical symptoms and quantitative analysis results | journal = Leg Med (Tokyo) | volume = 58 | pages = 102085 | date = September 2022 | pmid = 35537301 | doi = 10.1016/j.legalmed.2022.102085 | s2cid = 248602483 }} It is a synthetic cathinone. In 2021, eutylone was the most common cathinone identified by the Drug Enforcement Administration in the United States.{{cite web | url = https://cesar.umd.edu/sites/cesar.umd.edu/files/pubs/DEA-Emerging-Threat-Report-2021-Mid-Year.pdf | title = Emerging Threat Report | date = 2021 }}