:Fenamic acid

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 414204436

| ImageFile=Fenamic acid.png

| ImageClass = skin-invert-image

| ImageSize=200px

| ImageFile1=Fenamic acid 3D ball.png

| ImageAlt1=Ball-and-stick model of fenamic acid

| PIN=2-Anilinobenzoic acid

| OtherNames=N-phenylanthranilic acid

|Section1={{Chembox Identifiers

| IUPHAR_ligand = 4182

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=91-40-7

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 952VN06WBB

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 34756

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 23832

| SMILES=C1=CC=C(C=C1)NC2=CC=CC=C2C(=O)O

| PubChem = 4386

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 4233

| InChI = 1/C13H11NO2/c15-13(16)11-8-4-5-9-12(11)14-10-6-2-1-3-7-10/h1-9,14H,(H,15,16)

| InChIKey = ZWJINEZUASEZBH-UHFFFAOYAQ

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C13H11NO2/c15-13(16)11-8-4-5-9-12(11)14-10-6-2-1-3-7-10/h1-9,14H,(H,15,16)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = ZWJINEZUASEZBH-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| Formula=C₁₃H₁₁NO₂

| MolarMass=213.23 g/mol

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Fenamic acid is an organic compound, which, especially in its ester form, is called fenamate.Gupta, PK. Drug NomenclatureUnited States Adopted Names. Ch 27 in Remington: The Science and Practice of Pharmacy, Vol 1. Eds. David B. Troy, Paul Beringer. Lippincott Williams & Wilkins, 2006 {{ISBN|9780781746731}}{{rp|458}} serves as a parent structure for several nonsteroidal anti-inflammatory drugs (NSAIDs), including mefenamic acid, tolfenamic acid, flufenamic acid, and meclofenamic acid. These drugs are commonly referred to as "anthranilic acid derivatives" or "fenamates" because fenamic acid is a derivative of anthranilic acid.Sriram D, Yogeeswari P. [https://books.google.com/books?id=tUSLclf_NoQC&pg=PA235 Medicinal Chemistry, 2nd Edition]. Pearson Education India, 2010. {{ISBN|9788131731444}}{{rp|235}}Auburn University course material. Jack DeRuiter, Principles of Drug Action 2, Fall 2002 1: [http://www.auburn.edu/~deruija/nsaids_2002.pdf Non-Steroidal Antiinflammatory Drugs (NSAIDS)]{{rp|17}}

Fenamic acid can be synthesized from 2-chlorobenzoic acid and can be converted into acridone.{{cite journal| title = Acridone | author = C. F. H. Allen, G. H. W. McKee | journal = Organic Syntheses | volume = 2 | pages = 6| doi= 10.15227/orgsyn.019.0006| year = 1939}}