:Finrozole

{{Chembox

| ImageFile = Finrozole.svg

| ImageSize = 230

| ImageAlt =

| PIN = 4-[(1R,2S)-3-(4-Fluorophenyl)-2-hydroxy-1-(1H-1,2,4-triazol-1-yl)propyl]benzonitrile

| OtherNames =

| Section1 = {{Chembox Identifiers

| CASNo = 160146-17-8

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 40028KHQ6B

| PubChem = 6918277

| ChemSpiderID = 5293483

| ChEMBL = 2218882

| InChI = 1S/C18H15FN4O/c19-16-7-3-13(4-8-16)9-17(24)18(23-12-21-11-22-23)15-5-1-14(10-20)2-6-15/h1-8,11-12,17-18,24H,9H2/t17-,18+/m0/s1

| InChIKey = SLJZVZKQYSKYNV-ZWKOTPCHSA-N

| SMILES = C1=CC(=CC=C1C[C@@H]([C@@H](C2=CC=C(C=C2)C#N)N3C=NC=N3)O)F

}}

| Section6 = {{Chembox Pharmacology

| Pharmacology_ref =

| ATCCode_prefix = G03

| ATCCode_suffix = XX90

| ATC_Supplemental =

| ATCvet = Yes

| Licence_EU =

| INN =

| INN_EMA =

| Licence_US =

| Legal_status =

| Legal_AU =

| Legal_AU_comment =

| Legal_CA =

| Legal_CA_comment =

| Legal_NZ =

| Legal_NZ_comment =

| Legal_UK =

| Legal_UK_comment =

| Legal_US =

| Legal_US_comment =

| Legal_EU = Rx-only

| Legal_EU_comment = {{cite web | title=Prevestrus vet PI | website=Union Register of medicinal products | date=25 April 2025 | url=https://ec.europa.eu/health/documents/community-register/html/v338.htm | access-date=3 May 2025}}

| Legal_UN =

| Legal_UN_comment =

| Pregnancy_category =

| Pregnancy_AU =

| Pregnancy_AU_comment =

| Dependence_liability =

| AdminRoutes =

| Bioavail =

| ProteinBound =

| Metabolism =

| Metabolites =

| OnsetOfAction =

| HalfLife =

| DurationOfAction =

| Excretion =

}}

}}

Finrozole is an aromatase (CYP19A1) inhibitor.{{cite journal|pmid=23402939|year=2013|last1=Huuskonen|first1=P|last2=Myllynen|first2=P|last3=Storvik|first3=M|last4=Pasanen|first4=M|title=The effects of aflatoxin B1 on transporters and steroid metabolizing enzymes in JEG-3 cells|volume=218|issue=3|pages=200–6|doi=10.1016/j.toxlet.2013.01.015|journal=Toxicology Letters}}

Finrozole was authorized for veterinary use in the European Union in April 2025.