:Forodesine

{{Short description|Chemical compound}}

{{Infobox drug

| INN =

| type =

| IUPAC_name = 7-[(2S,3S,4R,5R)-3,4-Dihydroxy-5-(hydroxymethyl)-2-pyrrolidinyl]-1,5-dihydropyrrolo[2,3-e]pyrimidin-4-one

| image = Immucillin H.svg

| width =

| alt =

| image2 =

| width2 =

| alt2 =

| imageL =

| widthL =

| altL =

| imageR =

| widthR =

| altR =

| caption =

| pronounce =

| tradename = Mundesine and Fodosine

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_US =

| pregnancy_US_comment =

| pregnancy_category=

| dependency_liability =

| addiction_liability =

| routes_of_administration = oral

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US =

| legal_US_comment =

| legal_UN =

| legal_UN_comment =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 209799-67-7

| CAS_supplemental =

| class =

| ATCvet =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 444499

| PubChemSubstance =

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 392417

| UNII = 426X066ELK

| KEGG = D06596

| ChEBI =

| ChEMBL = 218291

| NIAID_ChemDB =

| synonyms =

| chemical_formula =

| C=11 | H=14 | Ag= | Al= | As= | Au= | B= | Bi= | Br= | Ca= | Cl= | Co= | F= | Fe= | Gd= | I=

| K= | Li= | Mg= | Mn= | N=4 | Na= | O=4 | P= | Pt= | S= | Sb= | Se= | Sr= | Tc= | Zn= | charge=

| molecular_weight =

| SMILES = C1=C(C2=C(N1)C(=O)NC=N2)[C@H]3[C@@H]([C@@H]([C@H](N3)CO)O)O

| Jmol =

| StdInChI = 1S/C11H14N4O4/c16-2-5-9(17)10(18)7(15-5)4-1-12-8-6(4)13-3-14-11(8)19/h1,3,5,7,9-10,12,15-18H,2H2,(H,13,14,19)/t5-,7+,9-,10+/m1/s1

| StdInChI2 = 1/C11H14N4O4/c16-2-5-9(17)10(18)7(15-5)4-1-12-8-6(4)13-3-14-11(8)19/h1,3,5,7,9-10,12,15-18H,2H2,(H,13,14,19)/t5-,7+,9-,10+/m1/s1

| StdInChIKey = IWKXDMQDITUYRK-KUBHLMPHBW

| density =

| density_notes =

| melting_point =

| melting_high =

| melting_notes =

| boiling_point =

| boiling_notes =

| solubility =

| sol_units =

| specific_rotation =

}}

Forodesine (INN; also known as Immucillin H; trade names Mundesine and Fodosine) is a transition-state analog inhibitor of purine nucleoside phosphorylase{{cite journal | vauthors = Kicska GA, Long L, Hörig H, Fairchild C, Tyler PC, Furneaux RH, Schramm VL, Kaufman HL | display-authors = 6 | title = Immucillin H, a powerful transition-state analog inhibitor of purine nucleoside phosphorylase, selectively inhibits human T lymphocytes | journal = Proceedings of the National Academy of Sciences of the United States of America | volume = 98 | issue = 8 | pages = 4593–4598 | date = April 2001 | pmid = 11287638 | pmc = 31879 | doi = 10.1073/pnas.071050798 | doi-access = free | bibcode = 2001PNAS...98.4593K }} studied for the treatment of patients with T-cell acute lymphoblastic leukemia (T-ALL) and for treatment of B-cell acute lymphocytic leukemia (B-ALL).

Forodesine was originally discovered by Vern Schramm's laboratory at the Albert Einstein College of Medicine in New York and Industrial Research Limited in New Zealand.{{cn|date=February 2023}}

Forodesine is being developed by BioCryst Pharmaceuticals. {{As of|2008}}, it is currently in phase II clinical trials.{{cite web |url=http://www.clinicaltrials.gov/ct2/results?term=Forodesine&flds=Xabce |title=Complete list of clinical trials for forodesine (BCX-1777) (ClinicalTrials.gov) |access-date=2008-07-22}}{{update inline|date=March 2015}}.

In 2006, BioCryst entered into a licensing agreement with Mundipharma International Holdings Limited to develop and commercialize forodesine in markets across Europe, Asia, and Australasia for use in oncology.{{Cite press release | url = http://investor.shareholder.com/biocryst/releasedetail.cfm?releaseid=225663 | title = Biocryst Initiates Pivotal Fodosine Phase IIb Clinical Trial In Patients With Relapsed/Refractory T-Lymphoblastic Leukemia/Lymphoma | date = January 16, 2007}}

In April 2017, forodesine was approved in Japan for the treatment of relapsed/refractory peripheral T-cell lymphoma.{{Cite press release | url = http://investor.shareholder.com/biocryst/releasedetail.cfm?ReleaseID=1019740| title = BioCryst Announces Mundipharma Receives Approval for Mundesine in Japan| date = April 3, 2017}}{{cite journal | vauthors = Makita S, Maeshima AM, Maruyama D, Izutsu K, Tobinai K | title = Forodesine in the treatment of relapsed/refractory peripheral T-cell lymphoma: an evidence-based review | journal = OncoTargets and Therapy | volume = 11 | issue = | pages = 2287–2293 | date = 2018 | pmid = 29719411 | pmc = 5916385 | doi = 10.2147/OTT.S140756 | doi-access = free }}