:Fursultiamine

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = N-[(4-Amino-2-methylpyrimidin-5-yl)methyl]-N-{(1E)-4-hydroxy-1-methyl-2-[(tetrahydrofuran-2-ylmethyl)disulfanyl]but-1-en-1-yl}formamide

| image = Fursultiamine.png

| image_class = skin-invert-image

| alt = Skeletal formula of fursultiamine

| width = 200

| image2 = Fursultiamine 3D ball.png

| alt2 = Ball-and-stick model of the fursultiamine molecule

| width2 = 200

| tradename =

| Drugs.com = {{drugs.com|international|fursultiamine}}

| pregnancy_category =

| legal_status = otc

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 804-30-8

| ATC_prefix = None

| ATC_suffix =

| PubChem = 3002119

| ChEMBL = 1740659

| DrugBank_Ref = {{drugbankcite|changed|drugbank}}

| DrugBank = DB08966

| ChemSpiderID = 2273321

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 05J61265PX

| C=17 | H=26 | N=4 | O=3 | S=2

| smiles = O=CN(\C(=C(\SSCC1OCCC1)CCO)C)Cc2cnc(nc2N)C

}}

Fursultiamine (INN; chemical name thiamine tetrahydrofurfuryl disulfide or TTFD; brand names Adventan, Alinamin-F, Benlipoid, Bevitol Lipophil, Judolor, Lipothiamine) is a medication and vitamin used to treat thiamine deficiency. Chemically, it is a disulfide derivative of thiamine and is similar in structure to allithiamine.{{cite journal | vauthors = Lonsdale D | title = Thiamine tetrahydrofurfuryl disulfide: a little known therapeutic agent | journal = Medical Science Monitor | volume = 10 | issue = 9 | pages = RA199–203 | date = September 2004 | pmid = 15328496 | url = http://www.medscimonit.com/fulltxt.php?ICID=11763 }}

It was synthesized in Japan in the 1960s from allithiamine for the purpose of developing forms of thiamine with improved lipophilicity for treating vitamin B₁ deficiency (i.e., beriberi), It was subsequently commercialized not only in Japan but also in Spain, Austria, Germany, and the United States.{{cite book | author = Swiss Pharmaceutical Society | title = Index Nominum 2000: International Drug Directory (Book with CD-ROM) | publisher = Medpharm Scientific Publishers | location = Boca Raton | year = 2000 | pages = 1932 | isbn = 3-88763-075-0 | url = https://books.google.com/books?id=5GpcTQD_L2oC&q=fursultiamine&pg=PA478}}