:Fursultiamine
{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name = N-[(4-Amino-2-methylpyrimidin-5-yl)methyl]-N-
| image = Fursultiamine.png
| image_class = skin-invert-image
| alt = Skeletal formula of fursultiamine
| width = 200
| image2 = Fursultiamine 3D ball.png
| alt2 = Ball-and-stick model of the fursultiamine molecule
| width2 = 200
| tradename =
| Drugs.com = {{drugs.com|international|fursultiamine}}
| pregnancy_category =
| legal_status = otc
| routes_of_administration = Oral
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 804-30-8
| ATC_prefix = None
| ATC_suffix =
| PubChem = 3002119
| ChEMBL = 1740659
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB08966
| ChemSpiderID = 2273321
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 05J61265PX
| C=17 | H=26 | N=4 | O=3 | S=2
| smiles = O=CN(\C(=C(\SSCC1OCCC1)CCO)C)Cc2cnc(nc2N)C
}}
Fursultiamine (INN; chemical name thiamine tetrahydrofurfuryl disulfide or TTFD; brand names Adventan, Alinamin-F, Benlipoid, Bevitol Lipophil, Judolor, Lipothiamine) is a medication and vitamin used to treat thiamine deficiency. Chemically, it is a disulfide derivative of thiamine and is similar in structure to allithiamine.{{cite journal | vauthors = Lonsdale D | title = Thiamine tetrahydrofurfuryl disulfide: a little known therapeutic agent | journal = Medical Science Monitor | volume = 10 | issue = 9 | pages = RA199–203 | date = September 2004 | pmid = 15328496 | url = http://www.medscimonit.com/fulltxt.php?ICID=11763 }}
It was synthesized in Japan in the 1960s from allithiamine for the purpose of developing forms of thiamine with improved lipophilicity for treating vitamin B1 deficiency (i.e., beriberi), It was subsequently commercialized not only in Japan but also in Spain, Austria, Germany, and the United States.{{cite book | author = Swiss Pharmaceutical Society | title = Index Nominum 2000: International Drug Directory (Book with CD-ROM) | publisher = Medpharm Scientific Publishers | location = Boca Raton | year = 2000 | pages = 1932 | isbn = 3-88763-075-0 | url = https://books.google.com/books?id=5GpcTQD_L2oC&q=fursultiamine&pg=PA478}}
See also
References
{{reflist}}
Further reading
- {{cite journal | vauthors = Lonsdale D | title = Thiamine tetrahydrofurfuryl disulfide: a little known therapeutic agent | journal = Medical Science Monitor | volume = 10 | issue = 9 | pages = RA199–203 | date = September 2004 | pmid = 15328496 | url = http://www.medscimonit.com/fulltxt.php?ICID=11763 }}
{{Vitamins}}